CAS 55556-91-7
:1-nitrosopiperidin-4-one
Description:
1-Nitrosopiperidin-4-one is a chemical compound characterized by its nitroso group attached to a piperidinone structure. It features a six-membered ring containing five carbon atoms and one nitrogen atom, with a carbonyl group (ketone) at the 4-position and a nitroso group at the 1-position. This compound is typically a yellow to orange solid and is known for its potential use in organic synthesis and as an intermediate in the production of various nitrogen-containing compounds. It exhibits properties typical of nitroso compounds, such as being reactive towards nucleophiles and having the ability to participate in various chemical reactions, including oxidation and reduction processes. Additionally, 1-nitrosopiperidin-4-one may have implications in medicinal chemistry, although its biological activity and safety profile require careful evaluation due to the potential toxicity associated with nitroso compounds. Proper handling and storage conditions are essential to mitigate any risks associated with its use.
Formula:C5H8N2O2
InChI:InChI=1/C5H8N2O2/c8-5-1-3-7(6-9)4-2-5/h1-4H2
SMILES:C1CN(CCC1=O)N=O
Synonyms:- 4-Piperidinone, 1-Nitroso-
- N-Nitroso-4-piperidone
- 1-Nitrosopiperidin-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Nitroso-4-piperidone
CAS:Controlled ProductFormula:C5H8N2O2Color and Shape:NeatMolecular weight:128.13N-Nitroso-4-piperidone
CAS:N-Nitroso-4-piperidone is a nitrosating agent that has been shown to induce tumors in rats. It is thought to be carcinogenic by increasing the number of DNA adducts and inducing chromosomal aberrations. N-Nitroso-4-piperidone has been shown to react with 3-chloroperoxybenzoic acid, forming an intermediate that can undergo electrophilic substitution reactions on amines, leading to the formation of n-nitrosopiperidine. The nitrosating activity of N-Nitroso-4-piperidone has been studied in rat liver microsomes as well as in model systems using esophageal tissue from Sprague Dawley rats.Formula:C5H8N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:128.13 g/mol


