CAS 55556-94-0
:2-methyl-1,4-dinitrosopiperazine
Description:
2-Methyl-1,4-dinitrosopiperazine is an organic compound characterized by its piperazine ring structure, which is substituted with two nitro groups and a methyl group. This compound typically appears as a crystalline solid and is known for its potential use in various chemical applications, including as an intermediate in organic synthesis. The presence of nitro groups contributes to its reactivity, making it a subject of interest in studies related to explosives and propellants. The compound's molecular structure influences its physical properties, such as solubility and stability, which can vary depending on environmental conditions. Additionally, due to the presence of nitro groups, 2-methyl-1,4-dinitrosopiperazine may exhibit specific toxicological properties, necessitating careful handling and storage. As with many nitro compounds, it may also be sensitive to heat and shock, which raises safety considerations in its use and application. Overall, this compound exemplifies the complexity and utility of nitro-substituted organic molecules in chemical research and industry.
Formula:C5H10N4O2
InChI:InChI=1/C5H10N4O2/c1-5-4-8(6-10)2-3-9(5)7-11/h5H,2-4H2,1H3
Synonyms:- 2-Methyl-1,4-dinitrosopiperazine
- piperazine, 2-methyl-1,4-dinitroso-
- 1,4-Dinitroso-2-methylpiperazine
- Gatifloxacin Impurity 22
- Piperazine, 2-methyl-1,4-dinitroso- (6CI,9CI)
- Gatifloxacin Impurity 37
- Olaquindox Impurity 5
- 2-METHYLDINITROSOPIPERAZINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
