CAS 5556-07-0

2-Acetyl-3-Hydroxythiophene

Description:

2-Acetyl-3-hydroxythiophene is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an acetyl group and a hydroxyl group attached to the thiophene ring, contributing to its unique chemical properties. It typically appears as a yellow to brown liquid or solid, depending on its purity and form. The presence of the hydroxyl group makes it capable of engaging in hydrogen bonding, which can influence its solubility in various solvents, often making it soluble in polar solvents. The acetyl group introduces a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. 2-Acetyl-3-hydroxythiophene is of interest in organic synthesis and may exhibit biological activity, making it relevant in medicinal chemistry. Its CAS number, 5556-07-0, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, this compound serves as a versatile building block in the synthesis of more complex organic molecules.

Formula: C₆H₆O₂S

InChI: InChI=1/C6H6O2S/c1-4(7)6-5(8)2-3-9-6/h2-3,8H,1H3

SMILES: CC(=O)c1c(ccs1)O

Synonyms:

• 1-(3-Hydroxythiophen-2-Yl)Ethanone

1-(3-Hydroxythiophen-2-yl)ethan-1-one

CAS: 5556-07-0

1-(3-Hydroxythiophen-2-yl)ethan-1-one is a hydrolyzable compound that has been shown to have microbicidal activity against food spoilage bacteria such as Bacillus cereus and Clostridium perfringens. It inhibits the growth of these bacteria by inhibiting the synthesis of bacterial cell walls, which leads to cell death.

Formula: C₆H₆O₂S

Purity: Min. 95%

Molecular weight: 142.18 g/mol

Ref: 3D-FAA55607