CAS 5556-76-3
:1,2,3-trimethoxy-5-[(1E)-2-nitroprop-1-en-1-yl]benzene
Description:
1,2,3-Trimethoxy-5-[(1E)-2-nitroprop-1-en-1-yl]benzene, with the CAS number 5556-76-3, is an organic compound characterized by its complex structure featuring a benzene ring substituted with three methoxy groups and a nitroalkene side chain. The presence of methoxy groups contributes to its electron-donating properties, which can enhance its reactivity in various chemical reactions, particularly in electrophilic aromatic substitution. The nitroprop-1-en-1-yl group introduces a reactive site that can participate in further chemical transformations, making this compound of interest in synthetic organic chemistry. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the compound's physical properties, such as solubility and melting point, would be influenced by the substituents on the benzene ring, which can affect its overall polarity and reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the nitro group, which can impart explosive characteristics under certain conditions.
Formula:C12H15NO5
InChI:InChI=1/C12H15NO5/c1-8(13(14)15)5-9-6-10(16-2)12(18-4)11(7-9)17-3/h5-7H,1-4H3/b8-5+
Synonyms:- 1-(3,4,5-Trimethoxyphenyl)-2-nitro-1-propene
- 1,2,3-Trimethoxy-5-(2-nitropropenyl)benzene
- 1,2,3-Trimethoxy-5-(2-nitro-propenyl)-benzene
- 1,2,3-Trimethoxy-5-[(1E)-2-nitro-1-propen-1-yl]benzene
- 1,2,3-Trimethoxy-5-[(1E)-2-nitro-1-propenyl]benzene
- Benzene, 1,2,3-trimethoxy-5-(2-nitropropenyl)-
- benzene, 1,2,3-trimethoxy-5-[(1E)-2-nitro-1-propen-1-yl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1-(3,4,5-Trimethoxyphenyl)-2-nitropropene
CAS:1-(3,4,5-Trimethoxyphenyl)-2-nitropropene is a high quality chemical that is a reagent and useful intermediate. It has been shown to be a useful scaffold for the synthesis of various compounds and as a building block for the synthesis of speciality chemicals. This compound can be used in research and as a versatile building block in organic chemistry.
Formula:C12H15NO5Purity:Min. 97 Area-%Color and Shape:PowderMolecular weight:253.25 g/mol
