CAS 5557-53-9

2,5-bis[(2-hydroxyethyl)amino]cyclohexa-2,5-diene-1,4-dione

Description:

2,5-bis[(2-hydroxyethyl)amino]cyclohexa-2,5-diene-1,4-dione, commonly known by its CAS number 5557-53-9, is an organic compound characterized by its unique structure that features a cyclohexadiene core with two hydroxyethylamino substituents. This compound exhibits properties typical of diketones, including potential reactivity due to the presence of the conjugated diene system, which can participate in various chemical reactions such as electrophilic addition and oxidation. The hydroxyethylamino groups contribute to its solubility in polar solvents and may enhance its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of hydroxyl groups can facilitate hydrogen bonding, influencing its physical properties such as melting point and boiling point. Its applications may extend to fields such as pharmaceuticals, where it could serve as an intermediate or active ingredient. However, specific safety and handling guidelines should be followed due to the potential reactivity of the compound.

Formula: C₁₀H₁₄N₂O₄

InChI: InChI=1/C10H14N2O4/c13-3-1-11-7-5-10(16)8(6-9(7)15)12-2-4-14/h5-6,11-14H,1-4H2

SMILES: C(CO)NC1=CC(=O)C(=CC1=O)NCCO

2,5-Bis((2-hydroxyethyl)amino)cyclohexa-2,5-diene-1,4-dione

CAS: 5557-53-9

2,5-Bis((2-hydroxyethyl)amino)cyclohexa-2,5-diene-1,4-dione

Purity: 97%

Molecular weight: 226.23g/mol

Ref: 54-OR1035182

2,5-bis[(2-hydroxyethyl)amino]benzo-1,4-quinone

CAS: 5557-53-9

Formula: C₁₀H₁₄N₂O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 226.232

Ref: 10-F374494