CAS 55576-66-4

(2S)-1-[3,5-bis(3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylbenzyl)-2,4,6-trihydroxyphenyl]-2-methylbutan-1-one

Description:

The chemical substance with the name "(2S)-1-[3,5-bis(3-butanoyl-2,6-dihydroxy-4-methoxy-5-methylbenzyl)-2,4,6-trihydroxyphenyl]-2-methylbutan-1-one" and CAS number "55576-66-4" is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as ketones, hydroxyls, and methoxy groups. This compound is likely to exhibit significant biological activity due to the presence of multiple hydroxyl groups, which can participate in hydrogen bonding and enhance solubility in polar solvents. The presence of the butanoyl groups suggests potential lipophilicity, which may influence its interaction with biological membranes. Additionally, the stereochemistry indicated by the (2S) configuration suggests specific spatial arrangements that could affect its reactivity and biological interactions. Overall, this compound may have applications in pharmaceuticals or as a biochemical probe, although specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₃₇H₄₆O₁₂

InChI: InChI=1/C37H46O12/c1-9-12-23(38)25-32(44)19(29(41)17(5)36(25)48-7)14-21-31(43)22(35(47)27(34(21)46)28(40)16(4)11-3)15-20-30(42)18(6)37(49-8)26(33(20)45)24(39)13-10-2/h16,41-47H,9-15H2,1-8H3/t16-/m0/s1

SMILES: CCCC(=O)c1c(c(Cc2c(c(Cc3c(c(C)c(c(C(=O)CCC)c3O)OC)O)c(c(C(=O)[C@@H](C)CC)c2O)O)O)c(c(C)c1OC)O)O

Synonyms:

• 1-Butanone, 1-(3,5-bis((2,6-dihydroxy-4-methoxy-3-methyl-5-(1-oxobutyl)phenyl)methyl)-2,4,6-trihydroxyphenyl)-2-methyl-, (S)-
• Agrimol B

Agrimol B

CAS: 55576-66-4

Formula: C₃₇H₄₆O₁₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 682.7539

Ref: IN-DA00DCD9

Agrimol B

CAS: 55576-66-4

Formula: C₃₇H₄₆O₁₂

Purity: ≥ 98.0%

Color and Shape: Light yellow powder

Molecular weight: 682.76

Ref: 7W-GY4733

Agrimol B

CAS: 55576-66-4

Agrimol B

Purity: ≥95%

Molecular weight: 682.75g/mol

Ref: 54-BUP06212

Agrimol B

CAS: 55576-66-4

Formula: C₃₇H₄₆O₁₂

Purity: 95%~99%

Molecular weight: 682.763

Ref: BP-BP0126

Agrimol B

CAS: 55576-66-4

1. Agrimol B is a main active ingredient isolated from Agrimonia pilosa Ledeb.

Formula: C₃₇H₄₆O₁₂

Purity: 99.06% - ≥95%

Color and Shape: Solid

Molecular weight: 682.75

Ref: TM-T4S1173

Agrimol B

CAS: 55576-66-4

Formula: C₃₇H₄₆O₁₂

Molecular weight: 682.77

Ref: 4Z-A-205001