CAS 55578-79-5

2-furan-2-ylaniline

Description:

2-Furan-2-ylaniline, with the CAS number 55578-79-5, is an organic compound that features both a furan ring and an aniline moiety. This compound is characterized by its aromatic properties, stemming from the furan and aniline structures, which contribute to its potential reactivity and stability. The presence of the furan ring, a five-membered heterocyclic compound containing oxygen, imparts unique electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. The amino group (-NH2) in the aniline part enhances its nucleophilicity, allowing for further functionalization. 2-Furan-2-ylaniline may exhibit solubility in organic solvents and has potential applications in pharmaceuticals, agrochemicals, and materials science due to its ability to participate in diverse chemical reactions. Additionally, its structural features may influence its biological activity, making it of interest in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if not managed properly.

Formula: C₁₀H₉NO

InChI: InChI=1/C10H9NO/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7H,11H2

SMILES: c1ccc(c(c1)c1ccco1)N

Synonyms:

• 2-(2-Furyl)Aniline
• Benzenamine, 2-(2-Furanyl)-

2-(Fur-2-yl)aniline

CAS: 55578-79-5

2-(Fur-2-yl)aniline

Purity: 95%

Color and Shape: Pale Yellow Liquid

Molecular weight: 159.18g/mol

Ref: 54-OR9658

2-(Furan-2-yl)aniline

CAS: 55578-79-5

Purity: 97%

Molecular weight: 159.1880035

Ref: 10-F722121