CAS 55579-71-0

5-(3-Chlorophenyl)-1,3-cyclohexanedione

Description:

5-(3-Chlorophenyl)-1,3-cyclohexanedione is an organic compound characterized by its cyclohexanedione structure, which features two carbonyl (C=O) groups located at the 1 and 3 positions of the cyclohexane ring. The presence of a 3-chlorophenyl group at the 5 position introduces both aromaticity and halogen substitution, which can influence the compound's reactivity and physical properties. This compound typically appears as a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are influenced by the electron-withdrawing nature of the chlorine atom, which can affect the acidity of the hydrogen atoms adjacent to the carbonyl groups. Additionally, 5-(3-Chlorophenyl)-1,3-cyclohexanedione may participate in various chemical reactions, including nucleophilic additions and condensation reactions, making it of interest in synthetic organic chemistry. Its potential applications could span pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific uses would depend on further research and development.

Formula: C₁₂H₁₁ClO₂

InChI: InChI=1S/C12H11ClO2/c13-10-3-1-2-8(4-10)9-5-11(14)7-12(15)6-9/h1-4,9H,5-7H2

InChI key: InChIKey=YSNSALYPQQBIDC-UHFFFAOYSA-N

SMILES: O=C1CC(CC(=O)C1)C2=CC(Cl)=CC=C2

Synonyms:

• 1,3-Cyclohexanedione, 5-(3-Chlorophenyl)-
• 5-(3-Chlorophenyl)-1,3-cyclohexanedione

5-(3-CHLORO-PHENYL)-CYCLOHEXANE-1,3-DIONE

CAS: 55579-71-0

Formula: C₁₂H₁₁ClO₂

Purity: 98%

Molecular weight: 222.6675

Ref: IN-DA00D8NX

5-(3-Chlorophenyl)cyclohexane-1,3-dione

CAS: 55579-71-0

5-(3-Chlorophenyl)cyclohexane-1,3-dione

Purity: 99%

Molecular weight: 222.67g/mol

Ref: 54-OR94949

5-(3-Chlorophenyl)cyclohexane-1,3-dione

CAS: 55579-71-0

Formula: C₁₂H₁₁ClO₂

Purity: 98%

Molecular weight: 222.67

Ref: 10-F067244

5-(3-Chlorophenyl)cyclohexane-1,3-dione

CAS: 55579-71-0

5-(3-Chlorophenyl)cyclohexane-1,3-dione is a versatile building block. It can be used as a reagent, speciality chemical, or useful building block in the synthesis of complex compounds. 5-(3-Chlorophenyl)cyclohexane-1,3-dione is also used as a reaction component or scaffold in the synthesis of valuable chemicals. This chemical has high purity and quality.

Formula: C₁₂H₁₁ClO₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 222.67 g/mol

Ref: 3D-FC117691