CAS 55579-99-2
:4-(4-methoxyphenoxy)butanoic acid
Description:
4-(4-Methoxyphenoxy)butanoic acid, with the CAS number 55579-99-2, is an organic compound characterized by its aromatic and aliphatic functional groups. It features a butanoic acid moiety, which contributes to its carboxylic acid properties, including acidity and the ability to form salts and esters. The presence of the 4-methoxyphenoxy group enhances its hydrophobic characteristics while also providing potential for hydrogen bonding due to the hydroxyl group in the carboxylic acid. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents, with limited solubility in water. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a biochemical probe due to its ability to interact with biological systems. Additionally, the methoxy group can influence the compound's electronic properties and reactivity, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-14-9-4-6-10(7-5-9)15-8-2-3-11(12)13/h4-7H,2-3,8H2,1H3,(H,12,13)
SMILES:COc1ccc(cc1)OCCCC(=O)O
Synonyms:- Butanoic Acid, 4-(4-Methoxyphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-(4-Methoxyphenoxy)butanoic acid
CAS:Controlled Product4-(4-Methoxyphenoxy)butanoic acid is a reagent that yields an exothermic reaction when heated in hexane. It is used in the acylation of carboxylic acids with chlorides, forming esters. Impurities include chlorides and carbocations, which may react to form a reaction product. 4-(4-Methoxyphenoxy)butanoic acid is also used as an intermediate for making other compounds, including pharmaceuticals.Formula:C11H14O4Purity:Min. 95%Molecular weight:210.23 g/mol
