CymitQuimica logo

CAS 55586-26-0

:

4-Amino-3-hydroxy-benzonitrile

Description:
4-Amino-3-hydroxy-benzonitrile, also known by its CAS number 55586-26-0, is an organic compound characterized by the presence of an amino group (-NH2), a hydroxyl group (-OH), and a nitrile group (-C≡N) attached to a benzene ring. This compound typically appears as a solid and is soluble in polar solvents due to its functional groups. The amino and hydroxyl groups contribute to its potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the nitrile group enhances its reactivity, making it useful in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, 4-amino-3-hydroxy-benzonitrile may exhibit biological activity, which can be explored in medicinal chemistry. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical compound.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-4-5-1-2-6(9)7(10)3-5/h1-3,10H,9H2
InChI key:HKZPOGZBKIWMPO-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C#N)O)N
Synonyms:
  • 4-Amino-3-hydroxybenzonitrile
Found 4 products.