CAS 55592-40-0
:4-[(7alpha,17beta)-3,17-dihydroxyestra-1,3,5(10)-trien-7-yl]butanoic acid
Description:
The chemical substance known as 4-[(7alpha,17beta)-3,17-dihydroxyestra-1,3,5(10)-trien-7-yl]butanoic acid, with the CAS number 55592-40-0, is a synthetic derivative of estrogen, specifically a steroid hormone. It features a steroid backbone with hydroxyl groups at the 3 and 17 positions, which are critical for its biological activity. The butanoic acid side chain enhances its solubility and may influence its pharmacokinetic properties. This compound is primarily studied for its potential applications in hormone replacement therapy and its effects on various biological systems, including its role in modulating estrogen receptors. Its structural characteristics contribute to its affinity for estrogen receptors, making it relevant in research related to reproductive health and endocrine function. Additionally, the presence of multiple functional groups allows for various chemical interactions, which can be explored in medicinal chemistry for developing therapeutic agents. As with many steroid derivatives, its stability, solubility, and biological activity are influenced by its molecular structure.
Formula:C22H30O4
InChI:InChI=1/C22H30O4/c1-22-10-9-17-16-6-5-15(23)12-14(16)11-13(3-2-4-20(25)26)21(17)18(22)7-8-19(22)24/h5-6,12-13,17-19,21,23-24H,2-4,7-11H2,1H3,(H,25,26)/t13-,17-,18+,19+,21-,22+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Estradiol-7α-butyric Acid
CAS:Controlled ProductFormula:C22H30O4Color and Shape:NeatMolecular weight:358.471
