CAS 556-02-5: 3-(4-Hydroxyphenyl)-D-alanine
Description:3-(4-Hydroxyphenyl)-D-alanine, also known as D-Tyrosine, is an amino acid derivative characterized by the presence of a hydroxyl group on the phenyl ring, which enhances its solubility and reactivity. This compound features a chiral center, making it exist in two enantiomeric forms, with the D-form being biologically relevant. It is a non-essential amino acid that plays a crucial role in the biosynthesis of neurotransmitters, particularly dopamine, and is involved in various metabolic pathways. The hydroxyl group contributes to its polar nature, allowing it to participate in hydrogen bonding and interact with other biomolecules. D-Tyrosine is often utilized in biochemical research and has potential applications in pharmaceuticals and dietary supplements, particularly for its role in enhancing cognitive function and mood. Additionally, it can be synthesized through various chemical methods or derived from dietary sources, such as dairy products, meat, and certain nuts. Its stability and reactivity under physiological conditions make it an important compound in both biological and synthetic chemistry contexts.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m1/s1
InChI key:InChIKey=OUYCCCASQSFEME-MRVPVSSYSA-N
SMILES:O=C(O)C(N)CC1=CC=C(O)C=C1
- Synonyms:
- (2R)-2-Amino-3-(4-hydroxyphenyl)propanoic acid
- (2R)-2-Azaniumyl-3-(4-hydroxyphenyl)propanoate
- (R)-2-Amino-3-(4-hydroxyphenyl)propanoic acid
- (R)-Tyrosine
- 3-(4-Hydroxyphenyl)-<span class="text-smallcaps">D</span>-alanine
- <span class="text-smallcaps">D</span>-4-Hydroxyphenylalanine
- <span class="text-smallcaps">D</span>-Tyrosine
- <span class="text-smallcaps">D</span>-p-Tyrosine
- D-Tyr-OH
- D-Tyrosine
- See more synonyms
- H-<span class="text-smallcaps">D</span>-Tyr-OH
- H-D-Tyr-OH
- Tyrosine, <span class="text-smallcaps">D</span>-
