CAS 556-50-3: Glycylglycine

Description:Glycylglycine, also known as diglycine, is a dipeptide composed of two glycine amino acids linked by a peptide bond. Its chemical formula is C4H8N2O3, and it has a molecular weight of approximately 132.12 g/mol. Glycylglycine is a white, crystalline solid that is soluble in water, making it useful in various biochemical applications. It exhibits properties typical of amino acids, such as the ability to form zwitterions, which means it can carry both a positive and a negative charge depending on the pH of the solution. Glycylglycine is often used in peptide synthesis, as a buffering agent in biochemical assays, and in studies related to protein structure and function. Additionally, it has potential applications in pharmaceuticals and nutrition, particularly in formulations aimed at enhancing amino acid absorption. Its relatively simple structure allows for easy incorporation into larger peptides and proteins, making it a valuable compound in both research and industrial contexts.

Formula:C₄H₈N₂O₃

InChI:InChI=1S/C4H8N2O3/c5-1-3(7)6-2-4(8)9/h1-2,5H2,(H,6,7)(H,8,9)

InChI key:InChIKey=YMAWOPBAYDPSLA-UHFFFAOYSA-N

SMILES:O=C(O)CNC(=O)CN