CAS 55601-63-3
:5-oxoprolylprolyl-alpha-aspartylprolylasparaginylalanylphenylalanyltyrosylglycylleucylmethioninamide
Description:
The chemical substance known as "5-oxoprolylprolyl-alpha-aspartylprolylasparaginylalanylphenylalanyltyrosylglycylleucylmethioninamide," with the CAS number 55601-63-3, is a complex peptide composed of multiple amino acids. Its structure suggests that it may exhibit properties typical of peptides, such as the ability to form hydrogen bonds, engage in hydrophobic interactions, and potentially exhibit biological activity depending on its conformation. Peptides like this one can play roles in various biological processes, including signaling, enzyme activity, and cellular communication. The presence of diverse amino acids, including proline, aspartic acid, and phenylalanine, indicates that the peptide may have unique structural and functional characteristics. Additionally, the presence of an amide group suggests stability against hydrolysis, which is a common feature in peptide bonds. However, due to its complexity, detailed studies would be necessary to fully understand its specific properties, biological activity, and potential applications in fields such as biochemistry or pharmacology.
Formula:C57H79N13O16S
InChI:InChI=1/C57H79N13O16S/c1-30(2)24-37(52(81)64-35(48(59)77)20-23-87-4)63-46(74)29-60-50(79)38(26-33-14-16-34(71)17-15-33)66-53(82)39(25-32-10-6-5-7-11-32)65-49(78)31(3)61-51(80)40(27-44(58)72)67-54(83)42-12-9-22-70(42)57(86)41(28-47(75)76)68-55(84)43-13-8-21-69(43)56(85)36-18-19-45(73)62-36/h5-7,10-11,14-17,30-31,35-43,71H,8-9,12-13,18-29H2,1-4H3,(H2,58,72)(H2,59,77)(H,60,79)(H,61,80)(H,62,73)(H,63,74)(H,64,81)(H,65,78)(H,66,82)(H,67,83)(H,68,84)(H,75,76)
SMILES:CC(C)CC(C(=NC(CCSC)C(=N)O)O)N=C(CN=C(C(Cc1ccc(cc1)O)N=C(C(Cc1ccccc1)N=C(C(C)N=C(C(CC(=N)O)N=C(C1CCCN1C(=O)C(CC(=O)O)N=C(C1CCCN1C(=O)C1CCC(=N1)O)O)O)O)O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Uperolein
CAS:Uperolein, a physalaemin-like endecapeptide derived from the skin of Uperoleia rugosa and Uperoleia marmorata, exhibits spasmodic activity on theFormula:C57H79N13O16SMolecular weight:1234.38

