CAS 5561-87-5
:(±)-3-Hydroxydecanoic acid
Description:
(±)-3-Hydroxydecanoic acid, with the CAS number 5561-87-5, is a fatty acid characterized by its hydroxyl group located at the third carbon of a ten-carbon chain. This compound is a chiral molecule, existing as a racemic mixture of its enantiomers, which can exhibit different biological activities. It is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. The presence of the hydroxyl group imparts unique properties, such as increased solubility in water compared to other fatty acids, and it can participate in hydrogen bonding. This compound is of interest in various fields, including biochemistry and materials science, due to its potential applications in the synthesis of biodegradable polymers and surfactants. Additionally, it may play a role in metabolic pathways and has been studied for its effects on cellular processes. As with many fatty acids, it is important to handle (±)-3-Hydroxydecanoic acid with care, as it may have specific safety and environmental considerations.
Formula:C10H20O3
InChI:InChI=1S/C10H20O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h9,11H,2-8H2,1H3,(H,12,13)
InChI key:InChIKey=FYSSBMZUBSBFJL-UHFFFAOYSA-N
SMILES:C(C(CC(O)=O)O)CCCCCC
Synonyms:- (+-)-3-Hydroxydecanoic acid
- (RS)-3-Hydroxydecanoic acid
- 3-Hydroxidecanoic acid
- 3-Hydroxycapric acid
- Decanoic acid, 3-hydroxy-, (+-)-
- β-Hydroxycapric acid
- β-Hydroxydecanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
rac 3-Hydroxydecanoic Acid
CAS:Controlled Product<p>Applications rac 3-Hydroxydecanoic Acid (cas# 5561-87-5) is a compound useful in organic synthesis.<br></p>Formula:C10H20O3Color and Shape:NeatMolecular weight:188.26
