CAS 5561-99-9
:cis-11-Eicosenoic acid
Description:
Cis-11-Eicosenoic acid, also known as gadoleic acid, is a monounsaturated fatty acid characterized by a long carbon chain consisting of 20 carbon atoms and a single cis double bond located at the 11th carbon position from the carboxylic acid end. Its molecular formula is C20H38O2, and it has a molecular weight of approximately 314.5 g/mol. This fatty acid is typically found in various natural oils, particularly in fish oils and some plant oils. It is known for its potential health benefits, including anti-inflammatory properties and its role in maintaining cell membrane integrity. In terms of physical properties, cis-11-eicosenoic acid is generally a liquid at room temperature, with a relatively low melting point compared to saturated fatty acids of similar chain length. It is soluble in organic solvents but has limited solubility in water. The presence of the cis double bond contributes to its fluidity and reactivity, making it an important component in various biochemical processes and industrial applications, including cosmetics and food products.
Formula:C20H38O2
InChI:InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10H,2-8,11-19H2,1H3,(H,21,22)/b10-9-
InChI key:InChIKey=BITHHVVYSMSWAG-KTKRTIGZSA-N
SMILES:C(CC/C=C\CCCCCCCC)CCCCCCC(O)=O
Synonyms:- (11Z)-11-Eicosenoic acid
- (11Z)-icos-11-enoic acid
- (Z)-11-Eicosenoic acid
- 11-Eicosenoic acid, (11Z)-
- 11-Eicosenoic acid, (Z)-
- 11-cis-Eicosenoic acid
- 11Z-Eicosenoic acid
- Gondoic acid
- cis-11-Eicosenoic acid
- cis-Δ<sup>11</sup>-Eicosenoic acid
- cis-Δ11-Eicosenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Gondoic acid
CAS:Gondoic acid (cis-11-Eicosenoicacid) (cis-11-Eicosenoic acid) is a monounsaturated long-chain fatty acid that can be found in various plant oils and nuts [1].Formula:C20H38O2Purity:96.18% - 99.89%Color and Shape:Yellowish PasteMolecular weight:310.51cis-11-Eicosenoic acid
CAS:Formula:C20H38O2Purity:(GC) ≥ 98.0%Color and Shape:Colourless to light yellow liquidMolecular weight:310.51(11Z)-11-Eicosenoic Acid
CAS:Applications (11Z)-11-Eicosenoic Acid, is a monostaturated fatty acid. The combined C20:1 isomers constitute 70% of the total fatty acid pool in jojoba seed oil isolated from plants in the Arizona desert.
References Miwa, T.K. et al.: J. Am. Chem. Soc. 48(6), 259-264 (1971).;Formula:C20H38O2Color and Shape:White To Off-WhiteMolecular weight:310.51







