CAS 55610-01-0

Cepharadione A

Description:

Cepharadione A is a natural product classified as a secondary metabolite, specifically a type of antibiotic. It is derived from certain species of fungi, particularly those belonging to the genus Cephalosporium. This compound exhibits notable antibacterial properties, making it of interest in pharmaceutical research for potential therapeutic applications. Cepharadione A is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. The compound has been studied for its mechanism of action, which typically involves inhibiting bacterial cell wall synthesis, similar to other beta-lactam antibiotics. Additionally, its efficacy against various strains of bacteria highlights its potential as a lead compound for the development of new antimicrobial agents. However, further research is necessary to fully understand its pharmacokinetics, toxicity, and potential side effects in clinical settings. Overall, Cepharadione A represents a significant area of interest in the search for novel antibiotics amid rising antibiotic resistance.

Formula: C₁₈H₁₁NO₄

InChI: InChI=1S/C18H11NO4/c1-19-12-6-9-4-2-3-5-10(9)15-14(12)11(16(20)18(19)21)7-13-17(15)23-8-22-13/h2-7H,8H2,1H3

InChI key: InChIKey=RZIGKFTVXWUUCX-UHFFFAOYSA-N

SMILES: CN1C=2C3=C(C4=C(C=C3C(=O)C1=O)OCO4)C=5C(C2)=CC=CC5

Synonyms:

• 5H-1,3-benzodioxolo[6,5,4-de]benzo[g]quinoline-5,6(7H)-dione, 7-methyl-
• 5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione, 7-methyl-
• 7-Methyl-5H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione
• Cepharadione A
• NSC 650435

5H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinoline-5,6(7H)-dione, 7-methy l-

CAS: 55610-01-0

Formula: C₁₈H₁₁NO₄

Molecular weight: 305.2842

Ref: IN-DA00DK00

Cepharadione A

CAS: 55610-01-0

Cepharadione A is a naturally occurring DNA damaging agent.

Formula: C₁₈H₁₁NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 305.28

Ref: TM-TN3623

Cepharadione A

CAS: 55610-01-0

Formula: C₁₈H₁₁NO₄

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 305.289

Ref: BP-SBP02766

Cepharadione A

CAS: 55610-01-0

Cepharadione A is a polyketide antibiotic, which is a natural product isolated from certain bacterial or fungal sources. It exhibits a unique mode of action by interfering with bacterial cell wall biosynthesis, leading to cell lysis and death. Structurally, it includes a complex arrangement of carbon rings and functional groups that target specific bacterial enzymes involved in cell wall formation.

Formula: C₁₈H₁₁NO₄

Purity: Min. 95%

Molecular weight: 305.3 g/mol

Ref: 3D-FCA61001