CAS 55612-21-0
:2'-deoxy-2'-fluoro-5-iodouridine
Description:
2'-Deoxy-2'-fluoro-5-iodouridine is a nucleoside analog that features a fluorine atom at the 2' position and an iodine atom at the 5' position of the uridine structure. This compound is characterized by its ability to mimic natural nucleosides, which makes it of interest in medicinal chemistry, particularly in antiviral and anticancer research. The presence of the fluorine atom enhances its stability and bioavailability, while the iodine substitution can influence its interaction with nucleic acid targets. This compound is typically used in studies related to nucleic acid synthesis and can exhibit unique biological activities due to its structural modifications. Its chemical properties include solubility in polar solvents and potential reactivity under specific conditions, making it a valuable tool in biochemical assays and drug development. As a nucleoside analog, it may interfere with nucleic acid metabolism, providing insights into cellular processes and therapeutic applications.
Formula:C9H10FIN2O5
InChI:InChI=1/C9H10FIN2O5/c10-5-6(15)4(2-14)18-8(5)13-1-3(11)7(16)12-9(13)17/h1,4-6,8,14-15H,2H2,(H,12,16,17)/t4-,5-,6-,8?/m1/s1
SMILES:c1c(c(nc(=O)n1C1[C@@H]([C@@H]([C@@H](CO)O1)O)F)O)I
Synonyms:- Uridine, 2'-Deoxy-2'-Fluoro-5-Iodo-
- 5-Iodo-1-(2-Fluoro-2-Deoxyribofuranosyl)Uracil
- 2'-Deoxy-2'-fluoro-5-iodouridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-iodo-1-(2-fluoro-2-deoxyribofuranosyl)uracil
CAS:Formula:C9H10FIN2O5Purity:98%Color and Shape:SolidMolecular weight:372.08902'-Deoxy-2'-fluoro-5-iodouridine
CAS:2'-Deoxy-2'-fluoro-5-iodouridinePurity:≥95%Molecular weight:372.09g/mol5-IODO-1-(2-FLUORO-2-DEOXYRIBOFURANOSYL)URACIL
CAS:Formula:C9H10FIN2O5Purity:98%Molecular weight:372.0912’-epi-Fialuridine
CAS:Controlled Product<p>Applications An antiviral agent; nucleoside analog with antihepatitis B activity.<br>References Watanabe A., et al.: J. Med. Chem., 22, 21 (1979), Colacino, J.M., et al.: Antimicrob. Agents Chemother., 24, 505 (1983), Staschke, K.A., et al.: Antiviral Res., 23, 45 (1994), Cui, L., et al.: J. Clin. Invest., 95, 555 (1995),<br></p>Formula:C9H10FIN2O5Color and Shape:NeatMolecular weight:372.0892'-Deoxy-2'-fluoro-5-iodouridine
CAS:2'-Deoxy-2'-fluoro-5-iodouridine is a nucleoside, specifically a fluoro-modified and halo-nucleoside.Formula:C9H10FIN2O5Color and Shape:SolidMolecular weight:372.092'-Deoxy-2'-fluoro-5-iodouridine
CAS:<p>2'-Deoxy-2'-fluoro-5-iodouridine is a nucleoside analog that is a modified version of uridine, where the 2'-fluoro modification is added to the sugar (deoxyribose), and an iodine atom is attached at the 5' position of the uracil base. This combination of modifications provides unique properties that may be useful for research and therapeutic applications.</p>Formula:C9H10FIN2O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:372.09 g/molRef: 3D-ND07901
Discontinued product





