CAS 5562-61-8

N-tert-butyl-4-(4-ethylphenoxy)butan-1-amine

Description:

N-tert-butyl-4-(4-ethylphenoxy)butan-1-amine, with the CAS number 5562-61-8, is an organic compound characterized by its amine functional group and a branched alkyl chain. This compound features a tert-butyl group, which contributes to its steric bulk, and a 4-ethylphenoxy moiety that enhances its hydrophobic characteristics. The presence of the butan-1-amine structure indicates that it has a primary amine, which can participate in hydrogen bonding and may exhibit basic properties. The compound is likely to be a solid or viscous liquid at room temperature, depending on its molecular weight and structure. Its unique combination of hydrophobic and hydrophilic characteristics may make it useful in various applications, including as a surfactant or in the synthesis of more complex organic molecules. Additionally, the presence of the ethylphenoxy group may impart specific biological or chemical activity, making it of interest in pharmaceutical or agrochemical research. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₆H₂₇NO

InChI: InChI=1/C16H27NO/c1-5-14-8-10-15(11-9-14)18-13-7-6-12-17-16(2,3)4/h8-11,17H,5-7,12-13H2,1-4H3

SMILES: CCc1ccc(cc1)OCCCCNC(C)(C)C

Methylphenidate Impurity 2

CAS: 5562-61-8

Formula: C₁₃H₁₅NO

Color and Shape: White To Off-White Solid

Molecular weight: 201.27

Ref: 4Z-M-137005

cis-7-Phenyl-1-azabicyclo[4.2.0]octan-8-one

Controlled Product

CAS: 5562-61-8

Formula: C₁₃H₁₅NO

Color and Shape: Neat

Molecular weight: 201.264

Ref: TR-P556260