CAS 55623-37-5
:Oxaline
Description:
Oxaline, with the CAS number 55623-37-5, is a heterocyclic organic compound characterized by its five-membered ring structure containing both nitrogen and oxygen atoms. It is classified as an oxazole derivative, which typically features a nitrogen atom adjacent to an oxygen atom within the ring. Oxaline exhibits properties such as moderate solubility in polar solvents and may participate in various chemical reactions due to the presence of functional groups that can engage in nucleophilic or electrophilic interactions. Its structure allows for potential applications in pharmaceuticals and agrochemicals, as compounds with similar frameworks often display biological activity. Additionally, oxaline can serve as a building block in organic synthesis, contributing to the development of more complex molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use. Further research may be necessary to fully understand its reactivity and potential applications in various fields.
Formula:C24H25N5O4
InChI:InChI=1/C24H25N5O4/c1-6-22(2,3)23-12-19(32-4)21(31)28-18(11-15-13-25-14-26-15)20(30)27-24(23,28)29(33-5)17-10-8-7-9-16(17)23/h6-14H,1H2,2-5H3,(H,25,26)(H,27,30)/b18-11+/t23-,24?/m1/s1
InChI key:InChIKey=SOHAVULMGIITDH-ZXPSTKSJSA-N
SMILES:[C@@](C=C)(C)(C)[C@]12[C@]3(N(\C(=C\C4=CN=CN4)\C(=O)N3)C(=O)C(OC)=C1)N(OC)C=5C2=CC=CC5
Synonyms:- (3E,7aR,12aS)-7a-(1,1-Dimethyl-2-propen-1-yl)-7a,12-dihydro-3-(1H-imidazol-5-ylmethylene)-6,12-dimethoxy-1H,5H-imidazo[1′,2′:1,2]pyrido[2,3-b]indole-2,5(3H)-dione
- 1H,5H-Imidazo[1′,2′:1,2]pyrido[2,3-b]indole-2,5(3H)-dione, 7a-(1,1-dimethyl-2-propenyl)-7a,12-dihydro-3-(1H-imidazol-4-ylmethylene)-6,12-dimethoxy-, [7aR-(3E,7aR*,12aS*)]-
- Oxaline
- 1H,5H-Imidazo[1′,2′:1,2]pyrido[2,3-b]indole-2,5(3H)-dione, 7a-(1,1-dimethyl-2-propen-1-yl)-7a,12-dihydro-3-(1H-imidazol-5-ylmethylene)-6,12-dimethoxy-, (3E,7aR,12aS)-
- 1H,5H-Imidazo[1′,2′:1,2]pyrido[2,3-b]indole-2,5(3H)-dione, 7a-(1,1-dimethyl-2-propenyl)-7a,12-dihydro-3-(1H-imidazol-4-ylmethylene)-6,12-dimethoxy-, (3E,7aR,12aS)-
- (7aR,12aS)-7a-(1,1-Dimethyl-2-propenyl)-7a,12-dihydro-3-[(E)-(1H-imidazol-4-yl)methylene]-6,12-dimethoxy-1H,5H-imidazo[1',2':1,2]pyrido[2,3-b]indole-2,5(3H)-dione
- 1H,5H-Imidazo[1',2':1,2]pyrido[2,3-b]indole-2,5(3H)-dione, 7a-(1,1-dimethyl-2-propen-1-yl)-7a,12-dihydro-3-(1H-imidazol-5-ylmethylene)-6,12-dimethoxy-, (3E,7aR,12aS)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Oxaline
CAS:Formula:C24H25N5O4Purity:93.86%Color and Shape:Yellow amorphous solidMolecular weight:447.0Oxaline
CAS:OxalineFormula:C24H25N5O4Purity:By hplc: 92.87% (Typical Value in Batch COA)Color and Shape: yellow amorphous solidMolecular weight:447.49g/molOxaline
CAS:Oxaline is an inhibitor of kinases and proteins that has shown promise in the treatment of cancer. Derived from Chinese medicine, Oxaline has been found to be effective against various human cancer cell lines, including leukemia. Its mechanism of action involves inhibiting the cell cycle progression of cancer cells, leading to apoptosis or programmed cell death. Oxaline is also known to be excreted in urine, making it a potential biomarker for monitoring the effectiveness of treatment. As an inhibitor, Oxaline shows great potential in the development of novel therapies for cancer treatment.Formula:C24H25N5O4Purity:Min. 95%Molecular weight:447.5 g/molOxaline
CAS:Oxaline, a fungal alkaloid derived from Penicillium oxalicum, impedes tubulin polymerization, leading to cell cycle arrest at the M phase [1] [2].Formula:C24H25N5O4Color and Shape:SolidMolecular weight:447.49




