CAS 5565-32-2
:chlorotris(trimethylsilyl)silane
Description:
Chlorotris(trimethylsilyl)silane, with the CAS number 5565-32-2, is an organosilicon compound characterized by its unique structure, which includes a silicon atom bonded to three trimethylsilyl groups and one chlorine atom. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly in the presence of moisture, where it can hydrolyze to form silanol and hydrochloric acid. Chlorotris(trimethylsilyl)silane is often utilized as a reagent in organic synthesis and as a silylating agent, which enhances the stability and volatility of various compounds during analysis. Its ability to introduce trimethylsilyl groups makes it valuable in the preparation of silyl ethers and in the modification of surfaces in materials science. Additionally, it exhibits properties such as low volatility and high thermal stability, making it suitable for various applications in the fields of chemistry and materials engineering. Proper handling and storage are essential due to its reactivity and potential hazards associated with chlorine release.
Formula:C9H27ClSi4
InChI:InChI=1/C21H13NO4S2/c23-19-18(28-21(27)22(19)15-7-2-1-3-8-15)13-14-6-4-9-16(12-14)26-20(24)17-10-5-11-25-17/h1-13H/b18-13+
Synonyms:- 3-[(E)-(4-oxo-3-phenyl-2-thioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl furan-2-carboxylate
- Tris(Trimethylsilyl) Chlorosilane
- Tris(trimethylsilyl)silyl Chloride
- CHLOROTRIS(TRIMETHYLSILYL)SILANE
- 1,1,1,3,3,3-Hexamethyl-2-(trimethylsilyl)-2-chlorotrisilane
- Chlorotris(trimethylsilyl)silane solution
- Trisilane, 2-chloro-1,1,1,3,3,3-hexamethyl-2-(trimethylsilyl)-
- Chlorotris(trimethylsilyl)silane 97%
- Chlorotris(trimethylsilyl)silane >
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-chloro-1,1,1,3,3,3-hexamethyl-2-(trimethylsilyl)trisilane
CAS:Formula:C9H27ClSi4Purity:95.0%Color and Shape:SolidMolecular weight:283.1057Chlorotris(trimethylsilyl)silane
CAS:Chlorotris(trimethylsilyl)silanePurity:>95.0%Molecular weight:283.11g/molChlorotris(trimethylsilyl)silane
CAS:Formula:C9H27ClSi4Purity:>95.0%(GC)(T)Color and Shape:White to Almost white powder to lumpMolecular weight:283.11CHLOROTRIS(TRIMETHYLSILYL)SILANE
CAS:Purity:95%Color and Shape:SolidMolecular weight:283.109985351563Chlorotris(trimethylsilyl)silane
CAS:Chlorotris(trimethylsilyl)silane is a chlorosilane with a trifluoromethyl group and one other organic group. It can be prepared by thermal decomposition of chlorotrimethylsilane. Chlorotris(trimethylsilyl)silane has been used in the synthesis of branched-chain alkanes and cycloalkanes, as well as in the preparation of molecular fragments for use in organometallic syntheses. This molecule absorbs ultraviolet light strongly at 254 nm, making it useful for measurements of UV absorption spectra.
Formula:C9H27ClSi4Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:283.11 g/mol




