CAS 55662-34-5

5-Methylimidazo[1,2-a]pyrimidin-7(8H)-one

Description:

5-Methylimidazo[1,2-a]pyrimidin-7(8H)-one, with the CAS number 55662-34-5, is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings. This compound features a methyl group at the 5-position of the imidazole ring and a carbonyl group at the 7-position, contributing to its unique chemical properties. It is typically classified as a nitrogen-containing heterocycle, which can exhibit various biological activities. The presence of nitrogen atoms in its structure may influence its reactivity and interactions with biological systems. This compound is of interest in the field of medicinal chemistry and toxicology, particularly due to its potential formation during the cooking of certain foods, which raises concerns regarding its mutagenic and carcinogenic properties. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in experimental settings. Overall, 5-Methylimidazo[1,2-a]pyrimidin-7(8H)-one serves as a significant subject of study in understanding the implications of heterocyclic compounds in health and disease.

Formula: C₇H₇N₃O

InChI: InChI=1S/C7H7N3O/c1-5-4-6(11)9-7-8-2-3-10(5)7/h2-4H,1H3,(H,8,9,11)

InChI key: InChIKey=GVWALDUEYDNXOO-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC(=O)C1)NC=C2

Synonyms:

• Imidazo[1,2-a]pyrimidin-7(8H)-one, 5-methyl-
• Imidazo[1,2-a]pyrimidin-7(3H)-one, 5-methyl-
• 5-Methylimidazo[1,2-a]pyrimidin-7(8H)-one

5-Methyl-7H,8H-imidazo[1,2-a]pyrimidin-7-one

CAS: 55662-34-5

Versatile small molecule scaffold

Formula: C₇H₇N₃O

Purity: Min. 95%

Molecular weight: 149.15 g/mol

Ref: 3D-FCA66234