CAS 55666-11-0
:5-(2-Methylpropylidene)-2,4-imidazolidinedione
Description:
5-(2-Methylpropylidene)-2,4-imidazolidinedione, also known by its CAS number 55666-11-0, is a chemical compound characterized by its imidazolidinedione structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound typically exhibits properties associated with imides, such as being a solid at room temperature and having moderate solubility in polar solvents. Its molecular structure suggests potential reactivity due to the presence of the double bond in the side chain, which may participate in various chemical reactions, including nucleophilic additions or polymerization processes. The compound may also display biological activity, making it of interest in pharmaceutical research. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-(2-Methylpropylidene)-2,4-imidazolidinedione represents a unique class of compounds with potential applications in organic synthesis and medicinal chemistry.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-4(2)3-5-6(10)9-7(11)8-5/h3-4H,1-2H3,(H2,8,9,10,11)
InChI key:InChIKey=FKEBJFWQLNFBHG-UHFFFAOYSA-N
SMILES:C(C(C)C)=C1NC(=O)NC1=O
Synonyms:- 5-(2-Methylpropylidene)hydantoin
- Hydantoin, 5-isobutylidene-
- 5-Isobutylidenehydantoin
- 5-(2-Methylpropylidene)-2,4-imidazolidinedione
- 2,4-Imidazolidinedione, 5-(2-methylpropylidene)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
