CAS 55671-32-4
:Copper, [ethanedioato(2-)-κO1,κO2]-, hydrate (2:1)
Description:
The chemical substance known as Copper, [ethanedioato(2-)-κO1,κO2]-, hydrate (2:1), with the CAS number 55671-32-4, is a coordination complex of copper(II) with oxalate ligands. In this compound, copper is coordinated to two oxalate ions, which act as bidentate ligands, binding through two oxygen atoms. The "hydrate (2:1)" designation indicates that the complex includes water molecules in its structure, typically contributing to its stability and solubility. This compound exhibits characteristic properties of transition metal complexes, such as distinct colors due to d-d electronic transitions, and may display paramagnetism depending on the oxidation state of the copper. The oxalate ligands can influence the geometry of the complex, often resulting in a square planar or octahedral arrangement around the copper center. Additionally, this compound may have applications in various fields, including catalysis, materials science, and as a precursor in the synthesis of other copper-containing materials. Its stability and reactivity can be affected by factors such as pH and the presence of other ligands.
Formula:C2CuO4H2O
InChI:InChI=1S/C2H2O4.Cu.H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;1H2/q;+2;/p-2
InChI key:InChIKey=OCDUIJZBRQQGHA-UHFFFAOYSA-L
SMILES:O=C1C(=O)O[Cu]O1.O
Synonyms:- Copper oxalate (CuC2O4) hemihydrate
- Copper oxalate (CuC<sub>2</sub>O<sub>4</sub>) hemihydrate
- Copper(2+) oxalate hemihydrate
- Copper, [ethanedioato(2-)-κO<sup>1</sup>,κO<sup>2</sup>]-, hydrate (2:1)
- Copper,[ethanedioato(2-)-O,O']-, hydrate (2:1)
- Cupric oxalate hemihydrate
- Copper, [ethanedioato(2-)-κO1,κO2]-, hydrate (2:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Copper(II) oxalate hemihydrate
CAS:Copper(II) oxalate hemihydrate
Formula:CuC2O4·5H2OColor and Shape:blue pwdr.Molecular weight:151.57 (160.57)Copper Oxalate Hemihydrate
CAS:Controlled ProductApplications Copper Oxalate is an coordination compound used to engineer copper carbonate hydroxide photocatalysts.
References Xu, L., et al.: Int. J. Hydrogen. Energy., 39, 11486 (2014);Formula:C5H12N4Color and Shape:NeatMolecular weight:128.176

