CAS 556813-39-9: N~6~-(2-{[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino}ethyl)-3-nitropyridine-2,6-diamine
Description:N~6~-(2-{[4-(2,4-dichlorophenyl)-5-(1H-imidazol-2-yl)pyrimidin-2-yl]amino}ethyl)-3-nitropyridine-2,6-diamine, with CAS number 556813-39-9, is a complex organic compound characterized by its multi-ring structure and various functional groups. This substance features a pyrimidine core substituted with an imidazole and a nitro group, contributing to its potential biological activity. The presence of a dichlorophenyl moiety enhances its lipophilicity, which may influence its pharmacokinetic properties. The compound's amine groups suggest it may engage in hydrogen bonding, which is crucial for interactions with biological targets. Its structural complexity indicates potential applications in medicinal chemistry, particularly in the development of targeted therapies. The specific arrangement of substituents may also affect its solubility, stability, and reactivity, making it a subject of interest in drug design and synthesis. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in pharmaceutical chemistry.
Formula:C20H17Cl2N9O2
InChI:InChI=1/C20H17Cl2N9O2/c21-11-1-2-12(14(22)9-11)17-13(19-25-6-7-26-19)10-28-20(30-17)27-8-5-24-16-4-3-15(31(32)33)18(23)29-16/h1-4,6-7,9-10H,5,8H2,(H,25,26)(H3,23,24,29)(H,27,28,30)