CAS 55682-83-2
:methyl 3-hydroxytetradecanoate
Description:
Methyl 3-hydroxytetradecanoate, with the CAS number 55682-83-2, is an ester derived from tetradecanoic acid (also known as myristic acid) and methanol. This compound features a long hydrocarbon chain, which contributes to its hydrophobic characteristics, while the hydroxyl group at the third carbon position imparts some polar characteristics, making it amphiphilic. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. Methyl 3-hydroxytetradecanoate is soluble in organic solvents but has limited solubility in water due to its long carbon chain. This compound is of interest in various fields, including biochemistry and materials science, due to its potential applications in the synthesis of surfactants, emulsifiers, and other functional materials. Its properties can be influenced by factors such as temperature and the presence of other chemical species. As with many esters, it may undergo hydrolysis in the presence of water, reverting to its constituent acid and alcohol under appropriate conditions.
Formula:C15H30O3
InChI:InChI=1/C15H30O3/c1-3-4-5-6-7-8-9-10-11-12-14(16)13-15(17)18-2/h14,16H,3-13H2,1-2H3
SMILES:CCCCCCCCCCCC(CC(=O)OC)O
Synonyms:- Tetradecanoic Acid, 3-Hydroxy-, Methyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-hydroxy Myristic Acid methyl ester
CAS:3-hydroxy Myristic acid methyl ester found in Eucalyptus, combats M. tuberculosis, non-toxic to Vero cells, and in wild strawberry aroma, not in cultivated.Formula:C15H30O3Color and Shape:SolidMolecular weight:258.402Methyl 3-Hydroxytetradecanoate
CAS:Formula:C15H30O3Purity:>98%Color and Shape:LiquidMolecular weight:258.43-Hydroxy Myristic Acid Methyl Ester
CAS:Controlled Product<p>Applications 3-Hydroxytetradecanoic Acid Methyl Ester is used in the preparation of (S)-3-hydroxytetradecanoic acid and synthesis of unnatural analogs of lipid A containing the (S)-acid.<br>References Gouteux, B., et al.: Environ. Sci. Technol., 39, 1448 (2005), Esteve-Turrillas, F., et al.: J. Agric. Food Chem., 56, 1797 (2008),<br></p>Formula:C15H30O3Color and Shape:NeatMolecular weight:258.40


