CAS 55682-88-7: cis-11,14,17-eicosatrienoic acid methyl ester
Description:Cis-11,14,17-eicosatrienoic acid methyl ester, also known as methyl eicosatrienoate, is a methyl ester derived from eicosatrienoic acid, a polyunsaturated fatty acid. This compound features three double bonds located at the 11th, 14th, and 17th carbon positions in its carbon chain, which contributes to its unsaturated nature. The "cis" configuration indicates that the hydrogen atoms adjacent to the double bonds are on the same side, influencing its physical properties and biological activity. Typically, methyl esters like this one are characterized by their relatively low melting points and higher solubility in organic solvents compared to their corresponding fatty acids. This compound is of interest in various fields, including biochemistry and nutrition, due to its potential roles in cellular processes and as a precursor for bioactive lipids. Additionally, it may be studied for its applications in the production of biodiesel and as a component in various industrial formulations. Its CAS number, 55682-88-7, uniquely identifies it in chemical databases.
Formula:C21H36O2
InChI:InChI=1/C21H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23-2/h4-5,7-8,10-11H,3,6,9,12-20H2,1-2H3/b5-4+,8-7+,11-10+
