CymitQuimica logo

CAS 55689-64-0

:

Methyl 6,11-dihydro-11-oxodibenz[b,e]oxepin-2-acetate

Description:
Methyl 6,11-dihydro-11-oxodibenz[b,e]oxepin-2-acetate, with the CAS number 55689-64-0, is a chemical compound that belongs to the class of dibenzoxepins, which are characterized by their fused aromatic rings and oxygen-containing heterocycles. This compound features a methyl ester functional group, which contributes to its solubility and reactivity. It exhibits a complex structure that includes a bicyclic system, making it of interest in medicinal chemistry and organic synthesis. The presence of the oxo group indicates potential reactivity, particularly in nucleophilic addition reactions. Methyl 6,11-dihydro-11-oxodibenz[b,e]oxepin-2-acetate may possess biological activity, which could be explored for pharmaceutical applications. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C17H14O4
InChI:InChI=1S/C17H14O4/c1-20-16(18)9-11-6-7-15-14(8-11)17(19)13-5-3-2-4-12(13)10-21-15/h2-8H,9-10H2,1H3
InChI key:InChIKey=XHRCNWPQPFZGPK-UHFFFAOYSA-N
SMILES:O=C1C=2C(OCC=3C1=CC=CC3)=CC=C(CC(OC)=O)C2
Synonyms:
  • Methyl 6,11-dihydro-11-oxodibenz[b,e]oxepin-2-acetate
  • Dibenz[b,e]oxepin-2-acetic acid, 6,11-dihydro-11-oxo-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.