CAS 55690-47-6
:2-(11-oxo-6,11-dihydrodibenzo[b,e]oxepin-3-yl)propanoic acid
Description:
2-(11-oxo-6,11-dihydrodibenzo[b,e]oxepin-3-yl)propanoic acid, with the CAS number 55690-47-6, is a chemical compound that belongs to the class of dibenzoxepins, which are characterized by their fused aromatic rings and oxepin structure. This compound features a propanoic acid functional group, indicating it has acidic properties. The presence of the 11-oxo group suggests that it may exhibit reactivity typical of carbonyl compounds, potentially participating in various chemical reactions such as nucleophilic additions. The dibenzoxepin structure contributes to its unique physical and chemical properties, including potential biological activity. Compounds of this nature may be investigated for their pharmacological effects, as many dibenzoxepins have been studied for their therapeutic potential. The solubility, melting point, and stability of this compound would depend on its specific molecular interactions and the presence of functional groups. Overall, 2-(11-oxo-6,11-dihydrodibenzo[b,e]oxepin-3-yl)propanoic acid represents a complex organic molecule with potential applications in medicinal chemistry.
Formula:C17H14O4
InChI:InChI=1/C17H14O4/c1-10(17(19)20)11-6-7-14-15(8-11)21-9-12-4-2-3-5-13(12)16(14)18/h2-8,10H,9H2,1H3,(H,19,20)
Synonyms:- 6,11-Dihydro-α-methyl-11-oxodibenz[b,e]oxepine-3-acetic acid
- DD-3305
- DD 3505
- 2-(6,11-Dihydro-11-oxodibenz[b,e]oxepin-3-yl)propionic acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
DD-3305
CAS:<p>DD-3305 is a biochemical.</p>Formula:C17H14O4Color and Shape:SolidMolecular weight:282.29
