CAS 55696-57-6
:Manghaslin
Description:
Manghaslin, with the CAS number 55696-57-6, is a chemical compound that belongs to the class of natural products known as flavonoids. It is primarily derived from various plant sources and is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Manghaslin exhibits a range of biological activities, including anti-inflammatory and antimicrobial effects, making it of interest in pharmacological research. The compound is typically soluble in organic solvents and may have limited solubility in water, which is common for many flavonoids. Its stability can be influenced by factors such as pH and light exposure. Manghaslin's potential applications extend to food preservation and nutraceutical formulations, where its health benefits can be harnessed. As research continues, further exploration of its mechanisms of action and potential therapeutic uses is anticipated, highlighting the importance of natural compounds in modern medicine and health sciences.
Formula:C33H40O20
InChI:InChI=1S/C33H40O20/c1-9-19(38)23(42)26(45)31(48-9)47-8-17-21(40)25(44)30(53-32-27(46)24(43)20(39)10(2)49-32)33(51-17)52-29-22(41)18-15(37)6-12(34)7-16(18)50-28(29)11-3-4-13(35)14(36)5-11/h3-7,9-10,17,19-21,23-27,30-40,42-46H,8H2,1-2H3/t9-,10-,17+,19-,20-,21+,23+,24+,25-,26+,27+,30+,31+,32-,33-/m0/s1
InChI key:InChIKey=HKNBJSRIYRDSLB-MAWNCODISA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](O)[C@H](O)[C@@H](CO[C@H]6[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O6)O4
Synonyms:- 3-[(O-6-Deoxy-α-L-mannopyranosyl-(1→2)-O-[6-deoxy-α-L-mannopyranosyl-(1→6)]-β-D-glucopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one
- Manghaslin
- 4H-1-Benzopyran-4-one, 3-[(O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[6-deoxy-α-L-mannopyranosyl-(1→6)]-β-D-glucopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-
- Q2
- Quercetin 3-O-2G-rhamnosylrutinoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Quercetin 3-O-rutinoside-(1→2)-O-rhamnoside
CAS:Formula:C33H40O20Purity:95%~99%Molecular weight:756.663Manghaslin
CAS:Manghaslin inhibits α-glucosidase and AChE, suggesting anti-diabetic benefits from litchi pulp.Formula:C33H40O20Purity:99.83% - 99.98%Color and Shape:SolidMolecular weight:756.66Rhamnoside
CAS:Rhamnoside is a naturally occurring glycoside, which is a sugar molecule bound to a non-carbohydrate moiety, derived primarily from plants such as buckthorn and ginseng. It functions as a modulator within cellular systems, impacting pathways related to cell signaling, defense mechanisms, and stress responses. The glycosidic bond in Rhamnoside facilitates its interaction with proteins and enzymes, thereby influencing their activity and promoting various biological processes.
Formula:C33H40O20Purity:Min. 95%Molecular weight:756.7 g/molRef: 3D-FCA69657
Discontinued product



