CAS 5570-19-4
:2-Nitrophenylboronic acid
Description:
2-Nitrophenylboronic acid is an organic compound characterized by the presence of a boronic acid functional group attached to a nitrophenyl ring. It typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols. The compound features a boron atom bonded to a phenyl group that carries a nitro substituent at the ortho position, which influences its reactivity and properties. 2-Nitrophenylboronic acid is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and as a reagent in the development of sensors and drug delivery systems. Its boronic acid functionality allows it to participate in Suzuki-Miyaura cross-coupling reactions, which are essential in the formation of carbon-carbon bonds in organic chemistry. Additionally, the nitro group can serve as a handle for further functionalization, enhancing its versatility in synthetic applications. Safety precautions should be taken when handling this compound, as with many boronic acids, due to potential irritant properties.
Formula:C6H6BNO4
InChI:InChI=1S/C6H6BNO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4,9-10H
InChI key:InChIKey=SFUIGUOONHIVLG-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(N(=O)=O)C=CC=C1
Synonyms:- 2-Borononitrobenzene
- 2-Nitrobenzeneboronic acid
- 2-Nitrophenylboronic acid
- B-(2-Nitrophenyl)boronic acid
- Benzeneboronic acid, o-nitro-
- Boronic acid, (2-nitrophenyl)-
- Boronic acid, B-(2-nitrophenyl)-
- o-Nitrophenylboronic acid
- 2-nitrophenyl boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Nitrobenzeneboronic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6BNO4Purity:96%Color and Shape:White or cream to brown, Crystals or powder or crystalline powderMolecular weight:166.93(2-Nitrophenyl)boronic acid
CAS:Formula:C6H6BNO4Purity:98%Color and Shape:SolidMolecular weight:166.92712-Nitrobenzeneboronic acid
CAS:2-Nitrobenzeneboronic acidFormula:C6H6BNO4Purity:98%Color and Shape: off-white solidMolecular weight:166.92714g/mol2-Nitrophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H6BNO4Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:166.932-Nitrophenylboronic acid
CAS:Formula:C6H6BNO4Purity:96%Color and Shape:Solid, Powder or Crystalline Powder or Solid or ChunksMolecular weight:166.93




