CAS 557091-78-8

3-[(tert-butoxycarbonyl)amino]pentanoic acid

Description:

3-[(tert-butoxycarbonyl)amino]pentanoic acid, with the CAS number 557091-78-8, is an amino acid derivative characterized by the presence of a tert-butoxycarbonyl (Boc) protecting group on the amino functional group. This compound features a pentanoic acid backbone, which contributes to its aliphatic nature. The Boc group is commonly used in organic synthesis to protect amines during chemical reactions, allowing for selective functionalization of other reactive sites. The presence of both the carboxylic acid and the amine functional groups makes this compound amphoteric, capable of acting as both an acid and a base. Its solubility is influenced by the length of the carbon chain and the polar nature of the functional groups, typically making it soluble in polar solvents. This compound is often utilized in peptide synthesis and other applications in medicinal chemistry, where the protection of amino groups is crucial for the successful formation of peptide bonds. Overall, 3-[(tert-butoxycarbonyl)amino]pentanoic acid serves as an important intermediate in the synthesis of more complex molecules.

Formula: C₁₀H₁₉NO₄

InChI: InChI=1/C10H19NO4/c1-5-7(6-8(12)13)11-9(14)15-10(2,3)4/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13)

SMILES: CCC(CC(=O)O)N=C(O)OC(C)(C)C

Synonyms:

• Pentanoic Acid, 3-[[(1,1-Dimethylethoxy)Carbonyl]Amino]-
• 3-(Boc-amino)pentanoic acid

Pentanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]- (9CI)

CAS: 557091-78-8

Formula: C₁₀H₁₉NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.2622

Ref: IN-DA00DK2G

3-tert-Butoxycarbonylamino-pentanoic acid

CAS: 557091-78-8

3-tert-Butoxycarbonylamino-pentanoic acid

Purity: 97%

Molecular weight: 217.26g/mol

Ref: 54-OR307566

3-(BOC-AMINO)PENTANOIC ACID

CAS: 557091-78-8

Formula: C₁₀H₁₉NO₄

Purity: 97%

Color and Shape: Liquid, No data available.

Molecular weight: 217.265

Ref: 10-F387739