CAS 55715-03-2
:4-Bromomethyl-3-nitrobenzoic acid
Description:
4-Bromomethyl-3-nitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with both a bromomethyl group and a nitro group. The presence of the bromomethyl group introduces a halogen, which can influence the compound's reactivity and potential applications in organic synthesis. The nitro group, known for its electron-withdrawing properties, can affect the acidity of the carboxylic acid functional group, making it more acidic compared to unsubstituted benzoic acids. This compound is typically used in chemical synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to undergo further reactions such as nucleophilic substitutions. Additionally, its structural features may impart specific physical properties, such as solubility in organic solvents and varying melting points, depending on the presence of functional groups. Safety precautions should be observed when handling this compound, as it may pose health risks typical of halogenated and nitro-substituted compounds.
Formula:C8H5BrNO4
InChI:InChI=1/C8H6BrNO4/c9-4-6-2-1-5(8(11)12)3-7(6)10(13)14/h1-3H,4H2,(H,11,12)/p-1
SMILES:c1cc(CBr)c(cc1C(=O)[O-])N(=O)=O
Synonyms:- 4-(Bromomethyl)-3-Nitrobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromomethyl-3-nitrobenzoic acid, 97%
CAS:<p>4-Bromomethyl-3-nitrobenzoic acid is used as a reactant in the synthesis of 4-bromomethyl-3-nitrobenzoic acid succinimide ester, 4-((2-(hydroxymethyl)phenyl amino)methyl)-3-nitrobenzoic acid, 4-(2-hydroxyethylmercaptylmethyl)-3-nitrobenzoic acid. It is also used as a thiol photo-deprotection reagent</p>Formula:C8H5BrNO4Purity:97%Color and Shape:White to cream or pale yellow to pale brown, Crystalline powder or powderMolecular weight:259.044-(Bromomethyl)-3-nitrobenzoic acid
CAS:Formula:C8H6BrNO4Purity:95%Color and Shape:SolidMolecular weight:260.04154-Bromomethyl-3-nitro benzoic acid
CAS:4-Bromomethyl-3-nitro benzoic acidPurity:98%Molecular weight:260.04g/mol4-(Bromomethyl)-3-nitrobenzoic acid
CAS:Formula:C8H6BrNO4Purity:95%Color and Shape:SolidMolecular weight:260.043



