CAS 55716-66-0

4-Aminobenzocyclobutene

Description:

4-Aminobenzocyclobutene, with the CAS number 55716-66-0, is an organic compound characterized by its unique structure that combines a benzene ring with a cyclobutene moiety and an amino group. This compound typically exhibits a white to light yellow crystalline appearance. It is known for its potential applications in organic synthesis and materials science, particularly in the development of polymers and as a building block for more complex molecules. The presence of the amino group contributes to its reactivity, allowing for various chemical transformations, including nucleophilic substitutions and coupling reactions. Additionally, 4-Aminobenzocyclobutene may exhibit interesting electronic properties due to the conjugation between the aromatic and cyclobutene systems. Its solubility can vary depending on the solvent, and it is generally handled with care due to potential health hazards associated with amines. As with many organic compounds, proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₈H₉N

InChI: InChI=1/C8H9N/c9-8-4-3-6-1-2-7(6)5-8/h3-5H,1-2,9H2

SMILES: C1Cc2cc(ccc12)N

Synonyms:

• Bicyclo[4.2.0]Octa-1,3,5-Trien-3-Amine

4-Aminobenzocyclobutene

CAS: 55716-66-0

Formula: C₈H₉N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 119.1638

Ref: IN-DA00DEKR

Bicyclo[4.2.0]octa-1,3,5-trien-3-amine

CAS: 55716-66-0

Bicyclo[4.2.0]octa-1,3,5-trien-3-amine

Purity: 95%

Molecular weight: 119.17g/mol

Ref: 54-OR1075161

Bicyclo[4.2.0]octa-1,3,5-trien-3-amine

CAS: 55716-66-0

Formula: C₈H₇N

Purity: 95%

Molecular weight: 117.151

Ref: 10-F498924

4-Aminobenzocyclobutene

CAS: 55716-66-0

4-Aminobenzocyclobutene is a monomer that can be used as a crosslinker. It has been shown to have magnetic properties and is soluble in organic solvents such as dioxane and dichloromethane. 4-Aminobenzocyclobutene readily reacts with paraformaldehyde to form the corresponding paraformaldehyde resin, which is insoluble in water and can be used for the preparation of coatings or adhesives. The hydrosilylation reaction between 4-aminobenzocyclobutene and 3-chloropropyl trimethoxysilane leads to the formation of an aminosilane resin, which exhibits a low water absorption rate and high thermal expansion coefficient. This material can also be used for coating or adhesive applications.

Formula: C₈H₇N

Purity: Min. 95%

Molecular weight: 117.15 g/mol

Ref: 3D-FA152333