CAS 55718-76-8
:2-chloro-1,3,2-benzodioxaborole
Description:
2-Chloro-1,3,2-benzodioxaborole is an organoboron compound characterized by its unique bicyclic structure that incorporates both a dioxaborole and a chlorinated aromatic system. This compound features a boron atom bonded to a dioxole ring, which contributes to its reactivity and potential applications in organic synthesis and materials science. The presence of the chlorine atom enhances its electrophilic properties, making it useful in various chemical reactions, including cross-coupling reactions and as a building block in the synthesis of more complex molecules. Additionally, the compound's boron content allows for potential applications in medicinal chemistry, particularly in the development of boron-containing drugs or as a tool in boron neutron capture therapy. Its solubility and stability in organic solvents make it suitable for laboratory use, while its unique structural features may lead to interesting interactions with biological systems. Overall, 2-chloro-1,3,2-benzodioxaborole is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C6H4BClO2
InChI:InChI=1/C6H4BClO2/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H
SMILES:c1ccc2c(c1)OB(Cl)O2
Synonyms:- B-Chlorocatecholborane
- SS-CHLOROCATECHOLBORANE
- 2-Chlorobenzo[d][1,3,2]dioxaborole
- 2- chloro -1,3,2- benzodioxa boron heterocyclic pentene
- BETA-CHLOROCATECHOLBORANE
- iBi-Chlorocatecholborane
- 1,3,2-Benzodioxaborole, 2-chloro-
- ?Chlorocatecholborane
- 2-CHLORO-1,3,2-BENZODIOXABOROLE
- B-Chlorocatecholborane 97%
- 2-Chlorobenzo[d][1
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
B-Chlorocatecholborane
CAS:Formula:C6H4BClO2Purity:>96.0%(T)Color and Shape:White to Light yellow to Light red powder to crystalMolecular weight:154.362-Chlorobenzo[d][1,3,2]dioxaborole
CAS:Formula:C6H4BClO2Purity:96%Color and Shape:SolidMolecular weight:154.35882-Chlorobenzo[d][1,3,2]dioxaborole
CAS:2-Chlorobenzo[d][1,3,2]dioxaborolePurity:98%Molecular weight:154.36g/molB-Chlorocatecholborane
CAS:B-chlorocatecholborane is a nonpolar solvent that is used in the synthesis of drugs and other organic compounds. It reacts with trifluoromethanesulfonic acid to form a coordination complex, which can be used to synthesize pharmaceuticals. B-chlorocatecholborane can also be used for solid-phase synthesis, which offers an efficient method for chemical reactions. This reagent has been shown to react with 5-hydroxytryptamine 4 (5-ht4) receptor, which is involved in the regulation of appetite and sleep. It also reacts with 2-arachidonoylglycerol (2AG), a lipid molecule that mediates the effects of cannabis on appetite, pain and memory. The structure of this compound was determined using nuclear magnetic resonance spectroscopy and mass spectrometry. The biological properties of B-chlorocatecholborane have not yet been studied.Formula:C6H4BClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:154.36 g/mol




