CAS 55720-22-4
:5-Acenaphthenecarboxylic acid
Description:
5-Acenaphthenecarboxylic acid is an organic compound characterized by its bicyclic structure, which includes an acenaphthene moiety. This compound features a carboxylic acid functional group (-COOH) attached to the 5-position of the acenaphthene ring system. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 5-acenaphthenecarboxylic acid can serve as a building block in organic synthesis and may have applications in materials science and pharmaceuticals. Its unique structure and functional group make it a subject of interest in research related to organic chemistry and materials development. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H10O2
InChI:InChI=1/C13H10O2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7H,4-5H2,(H,14,15)
SMILES:c1cc2CCc3ccc(c(c1)c23)C(=O)O
Synonyms:- 5-Acenaphthylenecarboxylic acid, 1,2-dihydro-
- Nsc 137409
- 1,2-Dihydroacenaphthylene-5-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1,2-Dihydroacenaphthylene-5-carboxylic acid
CAS:Formula:C13H10O2Purity:97%Color and Shape:SolidMolecular weight:198.21735-Acenaphthenecarboxylic acid
CAS:5-Acenaphthenecarboxylic acid is a xylene derivative that has been characterized as an organometallic compound. The cyclopentane ring is the central feature of this molecule and it can be used in the synthesis of other organic compounds. 5-Acenaphthenecarboxylic acid is toxic to humans and animals and has been shown to induce liver tumors in rats. It also has been shown to inhibit the growth of some bacteria, including Mycobacterium tuberculosis, which causes tuberculosis. 5-Acenaphthenecarboxylic acid inhibits protein synthesis by binding to ribosomes and interfering with the biosynthesis of proteins. This binding prevents formation of a complex with the enzyme cell wall synthesis that is required for cell wall biosynthesis, inhibiting protein synthesis and cell division.Formula:C13H10O2Purity:Min. 95%Color and Shape:PowderMolecular weight:198.22 g/mol


