CAS 55720-37-1
:1,3,7-trichloronaphthalene
Description:
1,3,7-Trichloronaphthalene is a chlorinated aromatic compound derived from naphthalene, characterized by the presence of three chlorine atoms attached to the naphthalene ring at the 1, 3, and 7 positions. This compound typically appears as a colorless to pale yellow solid with a distinct aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as acetone and chloroform. 1,3,7-Trichloronaphthalene is known for its stability and resistance to degradation, which can raise environmental concerns regarding its persistence in ecosystems. It is primarily used in industrial applications, including as an intermediate in the synthesis of other chemicals and as a potential additive in various formulations. Due to its chlorinated nature, it may exhibit toxicological effects, necessitating careful handling and disposal. Additionally, it is important to consider its regulatory status, as chlorinated compounds can be subject to environmental regulations due to their potential impact on human health and the environment.
Formula:C10H5Cl3
InChI:InChI=1/C10H5Cl3/c11-7-2-1-6-3-8(12)5-10(13)9(6)4-7/h1-5H
SMILES:c1cc(cc2c1cc(cc2Cl)Cl)Cl
Synonyms:- Naphthalene, 1,3,7-Trichloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,3,7-Trichloronaphthalene
CAS:Controlled ProductFormula:C10H5Cl3Color and Shape:NeatMolecular weight:231.511,3,7-Trichloronaphthalene
CAS:<p>This validated method for the analysis of 1,3,7-trichloronaphthalene is based on a validated experimental method. It uses a set of structural coefficients and an experimental value to calculate the bioconcentration factor (BCF). The BCF is then used to calculate the optimum vector, which is found by using descriptors and structural factors. The experimental values are also used to determine the vector. This method has been validated experimentally and theoretically.</p>Formula:C10H5Cl3Purity:Min. 95%Color and Shape:PowderMolecular weight:231.5 g/mol

