CAS 55720-40-6
:2,3,6-trichloronaphthalene
Description:
2,3,6-Trichloronaphthalene is a chlorinated derivative of naphthalene, characterized by the presence of three chlorine atoms attached to the naphthalene ring at the 2, 3, and 6 positions. This compound typically appears as a colorless to pale yellow solid with a distinct aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as benzene and chloroform. 2,3,6-Trichloronaphthalene is known for its stability and resistance to degradation, which can lead to environmental persistence. It is primarily used in industrial applications, including as an intermediate in the synthesis of other chemicals and as a potential pesticide. Due to its chlorinated nature, it may exhibit toxicological effects, including potential carcinogenicity and environmental toxicity, necessitating careful handling and disposal. Safety measures should be observed when working with this compound to mitigate exposure risks.
Formula:C10H5Cl3
InChI:InChI=1/C10H5Cl3/c11-8-2-1-6-4-9(12)10(13)5-7(6)3-8/h1-5H
SMILES:c1cc(cc2cc(c(cc12)Cl)Cl)Cl
Synonyms:- Naphthalene, 2,3,6-Trichloro-
- 2,3,6-Trichloronaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3,6-Trichloronaphthalene
CAS:Controlled ProductFormula:C10H5Cl3Color and Shape:NeatMolecular weight:231.51
