CAS 55721-65-8
:Boc-D-isoleucine
Description:
Boc-D-isoleucine, with the CAS number 55721-65-8, is a protected form of the amino acid isoleucine, specifically the D-enantiomer. The "Boc" in its name refers to the tert-butyloxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group of amino acids. This compound is characterized by its hydrophobic nature due to the branched aliphatic side chain of isoleucine, which influences its solubility and interactions in biological systems. Boc-D-isoleucine is typically utilized in the synthesis of peptides and proteins, allowing for the selective modification of amino acids without interfering with the overall structure. It is stable under acidic conditions but can be deprotected under basic conditions or through specific reagents, facilitating the incorporation of isoleucine into larger peptide chains. As a synthetic intermediate, it plays a crucial role in research and pharmaceutical applications, particularly in the development of peptide-based therapeutics.
Formula:C11H21NO4
InChI:InChI=1/C11H21NO4/c1-6-7(2)8(9(13)14)12-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14)/t7?,8-/m1/s1
SMILES:CCC(C)[C@H](C(=O)O)N=C(O)OC(C)(C)C
Synonyms:- N-tert-Butyloxycarbonyl-D-isoleucine
- Boc-D-Ile-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Boc-D-Ile-OH
CAS:<p>Bachem ID: 4000565.</p>Formula:C11H21NO4Color and Shape:White PowderMolecular weight:231.29Boc-D-Ile-OH • 1/2 H2O
CAS:<p>Boc-D-Ile-OH is a cyclohexanone that can be used in peptide synthesis. It has been shown to have affinity for the Tools for Peptide Synthesis and is able to activate primary tumors with metastasis. Boc-D-Ile-OH has been shown to have kinetic parameters, and its pharmacophores are characterized by an organic chemistry approach. This compound is a serine protease inhibitor that blocks the activity of other serine proteases such as chymotrypsin and trypsin.</p>Formula:C13H21NO4H2OPurity:Min. 95%Molecular weight:240.3 g/mol
