CAS 55722-48-0
:methyl 2,3,4,6-tetra-O-acetyl-B-D-*thiogalactopyr
Description:
Methyl 2,3,4,6-tetra-O-acetyl-β-D-thiogalactopyranoside, with the CAS number 55722-48-0, is a synthetic derivative of galactose, specifically modified to include thiol functionality. This compound features four acetyl groups attached to the hydroxyl positions of the galactopyranoside ring, which enhances its stability and solubility in organic solvents. The presence of the thiol group imparts unique reactivity, making it useful in various chemical reactions, particularly in glycosylation processes and as a building block in carbohydrate chemistry. The acetyl groups can be removed under specific conditions, allowing for the regeneration of the hydroxyl groups for further functionalization. This compound is typically utilized in research settings, particularly in the synthesis of glycosides and other carbohydrate derivatives. Its structural characteristics contribute to its role in studies related to carbohydrate interactions, biological activity, and the development of glycomimetics. As with many chemical substances, proper handling and safety precautions should be observed due to potential reactivity and toxicity.
Formula:C15H22O9S
InChI:InChI=1/C15H22O9S/c1-7(16)20-6-11-12(21-8(2)17)13(22-9(3)18)14(23-10(4)19)15(24-11)25-5/h11-15H,6H2,1-5H3/t11-,12+,13+,14-,15+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside
CAS:Methyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside is a synthetic carbohydrate with the CAS number 55722-48-0. Methyl 2,3,4,6-tetra-O-acetyl-b-D-thiogalactopyranoside is used in the synthesis of oligosaccharides and monosaccharides. This product can be custom synthesized to meet your specifications. Methyl 2,3,4,6-tetra-O-acetyl-b -D -thiogalactopyranoside has been fluorinated and glycosylated for the synthesis of complex carbohydrates and saccharides. This product has high purity and can be customized to meet your specifications.Formula:C15H22O9SPurity:Min. 95%Molecular weight:378.4 g/mol

