CAS 55726-19-7

5-O-Trityl-2,3-O-isopropylidene-D-ribofuranose

Description:

5-O-Trityl-2,3-O-isopropylidene-D-ribofuranose is a carbohydrate derivative, specifically a protected form of D-ribofuranose, which is a pentose sugar. This compound features a trityl group at the 5-position and is protected at the 2 and 3 positions by isopropylidene groups, which enhance its stability and solubility in organic solvents. The trityl group serves as a protective group that can be removed under specific conditions, allowing for selective functionalization of the sugar moiety. The isopropylidene protection helps prevent unwanted reactions at the hydroxyl groups during synthetic procedures. This compound is typically used in organic synthesis, particularly in the preparation of nucleosides and nucleotides, due to its ability to undergo further chemical transformations while maintaining the integrity of the ribose structure. Its unique structural features make it valuable in the field of medicinal chemistry and biochemistry, where modifications of nucleosides are crucial for developing antiviral and anticancer agents.

Formula: C₂₇H₂₈O₅

InChI: InChI=1/C27H28O5/c1-26(2)31-23-22(30-25(28)24(23)32-26)18-29-27(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22-25,28H,18H2,1-2H3/t22-,23-,24-,25?/m1/s1

SMILES: CC1(C)O[C@@H]2[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)OC([C@@H]2O1)O

Synonyms:

• 2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose
• D-ribofuranose, 2,3-O-(1-methylethylidene)-5-O-(triphenylmethyl)-
• 2,3-O-(1-methylethylidene)-5-O-trityl-D-ribofuranose

2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose

CAS: 55726-19-7

Ref: 7W-GC6954

2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose

CAS: 55726-19-7

2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose is a metal complex that can be used as an antitumor agent. It has been shown to have antimicrobial activity against Gram positive and Gram negative bacteria and fungi. 2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose is also active against Gram negative bacteria such as Escherichia coli and Pseudomonas aeruginosa. This compound is easily synthesized from acetoacetic acid by the reaction with trifluoroacetic anhydride followed by ammonolysis or azide coupling. The product is then amidated or tosylated to give the desired product.
2,3-O-Isopropylidene - 5 - O - trityl - D - ribofuranose has also been shown to inhibit tumor growth in

Formula: C₂₇H₂₈O₅

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 432.51 g/mol

Ref: 3D-MI04096