CAS 55727-10-1
:2-Amino-6-mercapto-7-methylpurine ribonucleoside
Description:
2-Amino-6-mercapto-7-methylpurine ribonucleoside, with the CAS number 55727-10-1, is a purine nucleoside that features a ribose sugar linked to a modified purine base. This compound is characterized by the presence of an amino group at the 2-position, a mercapto group at the 6-position, and a methyl group at the 7-position of the purine ring. These modifications contribute to its unique chemical properties and biological activities. The ribonucleoside structure allows it to participate in various biochemical processes, particularly in nucleic acid metabolism and cellular signaling. It may exhibit antioxidant properties due to the presence of the thiol group, which can scavenge free radicals. Additionally, this compound can be involved in the synthesis of nucleotides and may have implications in research related to nucleic acid biochemistry and potential therapeutic applications. Its solubility and stability in biological systems are influenced by the ribose moiety and the functional groups on the purine base.
Formula:C11H15N5O4S
InChI:InChI=1S/C11H15N5O4S/c1-15-3-16(8-5(15)9(21)14-11(12)13-8)10-7(19)6(18)4(2-17)20-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2-,12,13,14,21)/t4-,6-,7-,10-/m1/s1
InChI key:InChIKey=RFHIWBUKNJIBSE-KQYNXXCUSA-N
SMILES:C[N+]=1C2=C(N(C1)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)NC([NH-])=NC2=S
Synonyms:- 2-Amino-6-mercapto-7-methylpurine ribonucleoside
- 2-Amino-6-mercapto-7-methyl-9-β-D-ribofuranosylpurinium hydroxide, inner salt
- 1H-Purinium, 2-amino-6,9-dihydro-7-methyl-9-β-D-ribofuranosyl-6-thioxo-, inner salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Methyl-6-thioguanosine inner salt
CAS:Formula:C11H15N5O4SPurity:85%Color and Shape:SolidMolecular weight:313.33297-Methyl-6-thioguanosine Chloride
CAS:Controlled ProductStability Unstable at Room Temperature
Applications 7-Methyl-6-thioguanosine Chloride is a compound useful in organic synthesis.Formula:C11H16ClN5O4SColor and Shape:NeatMolecular weight:349.797-Methyl-6-thioguanosine
CAS:MESG, a chromophoric substrate, can be used to quantitate inorganic phosphate.Formula:C11H15N5O4SPurity:98%Color and Shape:SolidMolecular weight:313.337-Methyl-6-thioguanosine inner salt
CAS:7-Methyl-6-thioguanosine inner salt is a compound that inhibits the activity of creatine kinase and phosphatase, which are enzymes involved in energy metabolism. It also binds to actin filaments and prevents their depolymerization. The binding mechanism of 7-methyl-6-thioguanosine inner salt is believed to be due to its ability to form disulfide bonds with cysteine residues on the surface of the enzyme. This inhibition has been shown to reduce the ATP production in mammalian cells and has been used as a model system for studying cellular processes.
Formula:C11H15N5O4SPurity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:313.33 g/mol




