CAS 55736-04-4

1-(2-chloro-6-hydroxyphenyl)ethanone

Description:

1-(2-Chloro-6-hydroxyphenyl)ethanone, with the CAS number 55736-04-4, is an organic compound characterized by its phenolic structure and the presence of a chloro substituent. This compound features a ketone functional group, specifically an ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The chloro group at the 2-position and the hydroxy group at the 6-position on the phenyl ring influence its chemical properties, including polarity and solubility. The hydroxy group can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential uses in the development of pharmaceuticals or agrochemicals. Additionally, the presence of the chloro substituent may impart unique reactivity patterns, making it a valuable intermediate in various chemical reactions. Overall, 1-(2-chloro-6-hydroxyphenyl)ethanone is a compound of interest due to its functional groups and potential applications in chemical research.

Formula: C₈H₇ClO₂

InChI: InChI=1/C8H7ClO2/c1-5(10)8-6(9)3-2-4-7(8)11/h2-4,11H,1H3

SMILES: CC(=O)c1c(cccc1O)Cl

Synonyms:

• Ethanone, 1-(2-Chloro-6-Hydroxyphenyl)-
• Ethanone, 1-(6-chloro-2-hydroxyphenyl)-

1-(2-Chloro-6-hydroxyphenyl)ethanone

CAS: 55736-04-4

Formula: C₈H₇ClO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.5930

Ref: IN-DA0039TI

1-(2-Chloro-6-hydroxyphenyl)ethan-1-one

CAS: 55736-04-4

1-(2-Chloro-6-hydroxyphenyl)ethan-1-one

Purity: 97%

Molecular weight: 170.59g/mol

Ref: 54-OR22395

1-(2-Chloro-6-hydroxyphenyl)ethanone

CAS: 55736-04-4

Formula: C₈H₇ClO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 170.59

Ref: 10-F079556