CymitQuimica logo

CAS 55748-93-1

:

4-(acetylamino)phenyl N-acetyl-L-cysteinate

Description:
4-(Acetylamino)phenyl N-acetyl-L-cysteinate, with the CAS number 55748-93-1, is a chemical compound that features a phenyl ring substituted with an acetylamino group and a cysteine derivative. This compound is characterized by its structural components, which include an acetylamino group that enhances its solubility and reactivity, and the N-acetyl-L-cysteinate moiety, which introduces thiol functionality. The presence of the thiol group is significant as it can participate in redox reactions and form disulfide bonds, making it relevant in biochemical processes. The compound may exhibit biological activity, potentially acting as an antioxidant or a precursor in the synthesis of other biologically active molecules. Its solubility in polar solvents and stability under physiological conditions are also notable characteristics. Overall, 4-(acetylamino)phenyl N-acetyl-L-cysteinate is of interest in medicinal chemistry and biochemistry due to its potential therapeutic applications and role in cellular processes.
Formula:C13H16N2O4S
InChI:InChI=1/C13H16N2O4S/c1-8(16)14-10-3-5-11(6-4-10)19-13(18)12(7-20)15-9(2)17/h3-6,12,20H,7H2,1-2H3,(H,14,16)(H,15,17)/t12-/m0/s1
SMILES:CC(=Nc1ccc(cc1)OC(=O)[C@H](CS)N=C(C)O)O
Synonyms:
  • L-Cysteine, N-acetyl-, 4-(acetylamino)phenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.