CAS 55749-97-8
:5-oxo-L-prolyl-L-glutaminyl-L-tryptophyl-L-alanyl-L-valylglycyl-L-histidyl-L-phenylalanyl-L-methioninamide
Description:
5-oxo-L-prolyl-L-glutaminyl-L-tryptophyl-L-alanyl-L-valylglycyl-L-histidyl-L-phenylalanyl-L-methioninamide, with the CAS number 55749-97-8, is a synthetic peptide that consists of a sequence of amino acids, which are the building blocks of proteins. This compound features a complex structure characterized by the presence of various functional groups typical of amino acids, including amine and carboxylic acid groups. The "5-oxo" designation indicates the presence of a ketone functional group, which can influence the peptide's reactivity and stability. As a peptide, it may exhibit biological activity, potentially interacting with specific receptors or enzymes in biological systems. Its hydrophilicity or hydrophobicity will depend on the composition and arrangement of the amino acids, affecting its solubility and interaction with cellular membranes. Such peptides can be of interest in pharmaceutical research, particularly in drug design and development, due to their potential therapeutic properties. However, specific biological activities and applications would require further investigation through experimental studies.
Formula:C51H68N14O11S
InChI:InChI=1/C51H68N14O11S/c1-27(2)43(51(76)56-25-42(68)60-39(22-31-24-54-26-57-31)50(75)63-37(20-29-10-6-5-7-11-29)49(74)61-34(44(53)69)18-19-77-4)65-45(70)28(3)58-48(73)38(21-30-23-55-33-13-9-8-12-32(30)33)64-47(72)36(14-16-40(52)66)62-46(71)35-15-17-41(67)59-35/h5-13,23-24,26-28,34-39,43,55H,14-22,25H2,1-4H3,(H2,52,66)(H2,53,69)(H,54,57)(H,56,76)(H,58,73)(H,59,67)(H,60,68)(H,61,74)(H,62,71)(H,63,75)(H,64,72)(H,65,70)/t28-,34-,35-,36-,37-,38-,39-,43-/m0/s1
SMILES:CC(C)[C@@H](C(=NCC(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCSC)C(=N)O)O)O)O)O)N=C([C@H](C)N=C([C@H](Cc1c[nH]c2ccccc12)N=C([C@H](CCC(=N)O)N=C([C@@H]1CCC(=N1)O)O)O)O)O
Synonyms:- Litorin
- Pyr-Gln-Trp-Ala-Val-Gly-His-Phe-Met-NH2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Litorin
CAS:Litorin suppresses appetite and stimulates smooth muscle, gastrin, gastric acid, and pancreatic secretion.Formula:C51H68N14O11SColor and Shape:White PowderMolecular weight:1085.24
