CAS 55750-05-5

1-[2-(diethylamino)ethyl]-3-(4-methoxybenzyl)quinoxalin-2(1H)-one hydrochloride

Description:

1-[2-(Diethylamino)ethyl]-3-(4-methoxybenzyl)quinoxalin-2(1H)-one hydrochloride, with the CAS number 55750-05-5, is a chemical compound that belongs to the class of quinoxaline derivatives. This substance typically exhibits properties such as being a white to off-white crystalline solid, which is soluble in water and various organic solvents, making it suitable for pharmaceutical applications. The presence of the diethylamino group suggests potential for interaction with biological systems, possibly influencing its pharmacological activity. The methoxybenzyl moiety may contribute to its lipophilicity, enhancing membrane permeability. As a hydrochloride salt, it is likely to have improved stability and solubility compared to its free base form. This compound may be investigated for its potential therapeutic effects, particularly in the fields of neuroscience or oncology, due to the structural characteristics that suggest activity at specific biological targets. However, detailed studies are necessary to fully elucidate its mechanism of action and therapeutic potential.

Formula: C₂₂H₂₈ClN₃O₂

InChI: InChI=1/C22H27N3O2.ClH/c1-4-24(5-2)14-15-25-21-9-7-6-8-19(21)23-20(22(25)26)16-17-10-12-18(27-3)13-11-17;/h6-13H,4-5,14-16H2,1-3H3;1H

SMILES: CCN(CC)CCn1c2ccccc2nc(Cc2ccc(cc2)OC)c1=O.Cl

CAROVERINEHYDROCHLORIDE

CAS: 55750-05-5

Formula: C₂₂H₂₈ClN₃O₂

Purity: 95%

Molecular weight: 401.9296

Ref: IN-DA00DPNN

Caroverine HCl

CAS: 55750-05-5

Formula: C₂₂H₂₈N₃O₂Cl

Molecular weight: 401.94

Ref: 4Z-C-10201

Caroverine hydrochloride

CAS: 55750-05-5

Caroverine HCL: Blocks NMDA/AMPA receptors, antioxidant, calcium-blocker, and vasorelaxant, used for tinnitus research.

Formula: C₂₂H₂₈ClN₃O₂

Purity: 98.37% - 98.75%

Color and Shape: Solid

Molecular weight: 401.9

Ref: TM-T9133