CAS 55750-49-7
:Ethyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-carboxylate
Description:
Ethyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-carboxylate, with the CAS number 55750-49-7, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features two carbonyl groups (dioxo) and an ethyl ester functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid or liquid at room temperature, depending on its purity and specific conditions. The presence of the carboxylate group enhances its solubility in polar solvents, making it useful in various chemical reactions, including condensation and cyclization processes. Ethyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-carboxylate may exhibit biological activity, which could be of interest in pharmaceutical research. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C7H7NO4
InChI:InChI=1/C7H7NO4/c1-2-12-7(11)8-5(9)3-4-6(8)10/h3-4H,2H2,1H3
InChI key:InChIKey=XUXSQROIUORWRI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)N1C(=O)C=CC1=O
Synonyms:- 1H-Pyrrole-1-carboxylic acid, 2,5-dihydro-2,5-dioxo-, ethyl ester
- Ethyl 2,5-dihydro-2,5-dioxo-1H-pyrrole-1-carboxylate
- N-Carbethoxymaleimide
- N-Ethoxycarbonylmaleimide
- NSC 266054
- ethyl 2,5-dioxo-2H-pyrrole-1(5H)-carboxylate
- Ethyl 2,5-Dioxopyrrole-1-carboxylate
- N-Ethyoxycarbonyl MaleiMide
- Ethyl 2,5-dioxo-2,5-dihydro-1H-pyrrole-1-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2,5-dioxo-2,5-dihydro-1H-pyrrole-1-carboxylate
CAS:Formula:C7H7NO4Purity:98%Color and Shape:SolidMolecular weight:169.1348Ethyl 2,5-dioxopyrrole-1-carboxylate
CAS:Ethyl 2,5-dioxopyrrole-1-carboxylatePurity:98%Molecular weight:169.13g/molEthyl 2,5-dioxopyrrole-1-carboxylate
CAS:Ethyl 2,5-dioxopyrrole-1-carboxylate is a synthetic compound that has been shown to be an efficient method for the preparation of copolymers. The reaction proceeds by reacting ethyl 2,5-dioxopyrrole-1-carboxylate with copolymerizable compounds such as orotic acid, amines, and maleimide. The copolymers are synthesized using a polymerization technique called atom transfer radical polymerization (ATRP). The molecular weight of the resulting polymer can be controlled by varying the ratio of ethyl 2,5-dioxopyrrole-1-carboxylate to monomer. Ethyl 2,5-dioxopyrrole-1-carboxylate is also used in elemental analyses and viscosity measurements.Formula:C7H7NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:169.14 g/molEthyl 2,5-dioxo-2,5-dihydro-1H-pyrrole-1-carboxylate
CAS:Formula:C7H7NO4Purity:98%Color and Shape:Solid, No data available.Molecular weight:169.136



