CAS 55750-61-3
:maleimidoacetic acid N-*hydroxysuccinimide ester
Description:
Maleimidoacetic acid N-hydroxysuccinimide ester, with the CAS number 55750-61-3, is a chemical compound commonly used in bioconjugation and protein labeling applications. This compound features a maleimide functional group, which is known for its ability to selectively react with thiol groups in proteins, facilitating the formation of stable thioether bonds. The presence of the N-hydroxysuccinimide (NHS) ester enhances the reactivity of the maleimide, allowing for efficient coupling to amine-containing molecules, such as amino acids or proteins. The compound is typically a white to off-white solid and is soluble in organic solvents like dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). Its reactivity and specificity make it valuable in various applications, including drug delivery systems, the development of biosensors, and the creation of antibody-drug conjugates. Proper handling and storage conditions are essential to maintain its stability and reactivity, as exposure to moisture or prolonged storage can lead to hydrolysis of the NHS ester.
Formula:C10H8N2O6
InChI:InChI=1/C10H8N2O6/c13-6-1-2-7(14)11(6)5-10(17)18-12-8(15)3-4-9(12)16/h1-2H,3-5H2
SMILES:C1=CC(=O)N(CC(=O)ON2C(=O)CCC2=O)C1=O
Synonyms:- 1-{2-[(2,5-dioxopyrrolidin-1-yl)oxy]-2-oxoethyl}-1H-pyrrole-2,5-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-Succinimidyl maleimidoacetate
CAS:Formula:C10H8N2O6Purity:95%Color and Shape:SolidMolecular weight:252.1803Ref: IN-DA003TC7
1kgTo inquire100gTo inquire250gTo inquire500gTo inquire100mg30.00€250mg40.00€1g69.00€5g158.00€25g568.00€2,5-Dioxopyrrolidin-1-Yl 2-(2,5-Dioxo-2,5-Dihydro-1H-Pyrrol-1-Yl)Acetate
CAS:2,5-Dioxopyrrolidin-1-Yl 2-(2,5-Dioxo-2,5-Dihydro-1H-Pyrrol-1-Yl)AcetatePurity:99%Molecular weight:252.18g/molAMAS
CAS:AMAS is a non-claevable heterobifunctional crosslinker with NHS ester and maleimide groups that enables covalent conjugation of amine- and sulfhydryl-containingFormula:C10H8N2O6Purity:99.98%Color and Shape:SolidMolecular weight:252.18Maleimidoacetic Acid N-Hydroxysuccinimide Ester
CAS:Controlled ProductApplications A hetero-bifunctional cross-linking reagent for the preparation of protein-protein or protein-hapten conjugates.
References Kitagawa, T., et al.: Chem. Pharm. Bull., 29, 1130 (1981), Sayre., L.M., et al.: J. Med. Chem., 27, 1325 (1984)Formula:C10H8N2O6Color and Shape:NeatMolecular weight:252.182,5-Dioxopyrrolidin-1-yl 2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)acetate
CAS:Formula:C10H8N2O6Purity:95%Color and Shape:SolidMolecular weight:252.182N-Succinimidyl Maleimidoacetate
CAS:Formula:C10H8N2O6Purity:>95.0%(qNMR)Color and Shape:White to Almost white powder to crystalMolecular weight:252.18






