
CAS 55750-86-2
:β-D-Glucopyranose, 1-[methyl (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedioate]
Description:
β-D-Glucopyranose, 1-[methyl (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedioate] is a complex organic compound characterized by its glucopyranose backbone, which is a six-membered cyclic form of glucose. The presence of the methyl ester group indicates that it is a derivative of glucopyranose, which can influence its solubility and reactivity. The long hydrocarbon chain with multiple double bonds (heptaenedioate) suggests that this compound may exhibit unique physical properties, such as increased hydrophobicity and potential for biological activity. The multiple double bonds also imply that it may participate in various chemical reactions, including oxidation and polymerization. This compound may be of interest in fields such as biochemistry, materials science, and pharmaceuticals due to its structural complexity and potential applications in drug delivery or as a biochemical probe. Its specific interactions and stability would depend on environmental conditions such as pH and temperature.
Formula:C27H36O9
InChI:InChI=1S/C27H36O9/c1-17(12-8-14-19(3)25(32)34-5)10-6-7-11-18(2)13-9-15-20(4)26(33)36-27-24(31)23(30)22(29)21(16-28)35-27/h6-15,21-24,27-31H,16H2,1-5H3/b7-6+,12-8+,13-9+,17-10+,18-11+,19-14+,20-15+/t21-,22-,23+,24-,27+/m1/s1
InChI key:InChIKey=ATQIQIBBBWQWOT-OMNKTTJZSA-N
SMILES:O(C(/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C(OC)=O)\C)\C)/C)/C)=O)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- 8,8′-Diapo-ψ,ψ-carotenedioic acid, β-D-glucopyranosyl methyl ester
- Crocin 4
- β-D-Glucopyranose, 1-[methyl (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethyl-2,4,6,8,10,12,14-hexadecaheptaenedioate]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Crocin-4
CAS:<p>Crocin-4, a saffron carotenoid, is an antioxidant that inhibits Aβ deposits in the brain and may aid Alzheimer's research with anti-tumor effects.</p>Formula:C27H36O9Color and Shape:SolidMolecular weight:504.576
