CAS 55758-32-2
:2-Fluoro-5-hydroxypyridine
Description:
2-Fluoro-5-hydroxypyridine is an organic compound characterized by a pyridine ring substituted with a fluorine atom at the second position and a hydroxyl group at the fifth position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits polar characteristics due to the presence of the hydroxyl group, which can engage in hydrogen bonding, influencing its solubility in water and organic solvents. The fluorine atom contributes to the compound's reactivity and can affect its electronic properties, making it useful in various chemical syntheses and applications. 2-Fluoro-5-hydroxypyridine may serve as an intermediate in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals. Its unique structure allows for potential interactions in biological systems, which can be explored for medicinal chemistry applications. As with many fluorinated compounds, it is essential to handle it with care, considering its potential environmental and health impacts.
Formula:C5H4FNO
InChI:InChI=1/C5H4FNO/c6-5-2-1-4(8)3-7-5/h1-3,8H
SMILES:c1cc(F)ncc1O
Synonyms:- 6-Fluoro-3-hydroxypyridine
- 6-Fluoropyridin-3-Ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Fluoro-5-hydroxypyridine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H4FNOPurity:95%Color and Shape:Crystals or powder or crystalline powder, Pale cream to cream to brownMolecular weight:113.092-Fluoro-5-hydroxypyridine
CAS:Formula:C5H4FNOPurity:98%Color and Shape:SolidMolecular weight:113.08982-Fluoro-5-hydroxypyridine
CAS:2-Fluoro-5-hydroxypyridineFormula:C5H4FNOPurity:98%Color and Shape: faint beige crystalline powderMolecular weight:113.09g/mol2-Fluoro-5-hydroxypyridine
CAS:Formula:C5H4FNOPurity:95%Color and Shape:Crystalline Powder,PowderMolecular weight:113.0912-Fluoro-5-hydroxypyridine
CAS:Formula:C5H4FNOPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:113.09





